
CAS Number31465-36-8
Synonyms4-(4-methoxyphenoxy)-benzenamine; 4-(4-Methoxyphenoxy)aniline; 4-(4-methoxyphenoxy)phenylamine; 4-(4'-methoxyphenoxy)aniline; 4-(4-Methoxy-phenoxy)-anilin
Molecular FormulaC13H13NO2
Molecular Weight215.248
Density1.2±0.1 g/cm3
Boiling Point359.6±27.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 31465-36-8 |
| Catalog No. | 2A-9084932 |
| Chinese Name | 4-(4-甲氧基苯氧基)苯胺 |
| Synonyms | 4-(4-methoxyphenoxy)-benzenamine; 4-(4-Methoxyphenoxy)aniline; 4-(4-methoxyphenoxy)phenylamine; 4-(4'-methoxyphenoxy)aniline; 4-(4-Methoxy-phenoxy)-anilin |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.248 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 359.6±27.0 °C at 760 mmHg |
| Storage Condition | Room temperature, protected from light, stored in |
| HTC | 2922299090 |
| SMILES | COc1ccc(Oc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H13NO2/c1-15-11-6-8-13(9-7-11)16-12-4-2-10(14)3-5-12/h2-9H,14H2,1H3 |
| InChI Key | VTYZDTAGEMAJMM-UHFFFAOYSA-N |
| MSDS | msds/84932_1_31465_36_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Aminononanoicacid | 5440-35-7 | 2A-9084923 |
| 2'-Aminoacetophenonehydrochloride | 25384-14-9 | 2A-9084924 |
| 4'-Aminoacetophenonehydrochloride | 41784-08-1 | 2A-9084926 |
| (1,1-Dioxidotetrahydrothien-3-yl)Hydrazine | 3448-12-2 | 2A-9084928 |
| 4-Isothiocyanato-4'-nitrodiphenylether | 19881-18-6 | 2A-9084931 |
| 4-Isothiocyanato-4'-nitrodiphenylsulfide | 19822-35-6 | 2A-9084933 |
| 2-(4-Methoxyphenoxy)ethanethioamide | 35370-92-4 | 2A-9084934 |
| 2-(4-Methoxyphenoxy)Acetamide | 30893-64-2 | 2A-9084936 |
| 3-Amino-4-(4MethoxyphenoxyBenzotrifluoride | 62966-74-9 | 2A-9084937 |
| 2-(2-Methoxyphenoxy)Acetamide | 183427-87-4 | 2A-9084939 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA