
CAS Number29711-79-3
Synonyms4-dimethylamino-1-naphthyl isothiocyanate; N-(4-Isothiocyanato-1-naphthyl)-N,N-dimethylamine; DANITO; 4-(dimethylamino)naphthalenisothiocyanate; 4-dimethylamino-1-napthylisothiocyanate; (4-(dimethylamino)naphthalen-1-yl)isothiocyanate; MFCD00003883; EINECS 249-800-3
Molecular FormulaC13H12N2S
Molecular Weight366.24
Density1.1g/cm3
Boiling Point376.6ºC at 760mmHg
Melting Point254-256 °C (lit.)
AppearanceSolid;White to Amber powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29711-79-3 |
| Catalog No. | 2A-9084884 |
| Chinese Name | 4-二甲氨基-1-萘异硫氰酸酯 |
| Synonyms | 4-dimethylamino-1-naphthyl isothiocyanate; N-(4-Isothiocyanato-1-naphthyl)-N,N-dimethylamine; DANITO; 4-(dimethylamino)naphthalenisothiocyanate; 4-dimethylamino-1-napthylisothiocyanate; (4-(dimethylamino)naphthalen-1-yl)isothiocyanate; MFCD00003883; EINECS 249-800-3 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 366.24 |
| Density | 1.1g/cm3 |
| Boiling Point | 376.6ºC at 760mmHg |
| Melting Point | 254-256 °C (lit.) |
| Appearance | Solid;White to Amber powder to crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2930909090 |
| PubChem ID | 57648873 |
| MDL Number | MFCD00031907 |
| SMILES | [I-].[H]\C(=C(\[H])c1cc[n+](C)cc1)c2ccc(cc2)N(C)C |
| InChI | 1S/C16H19N2.HI/c1-17(2)16-8-6-14(7-9-16)4-5-15-10-12-18(3)13-11-15;/h4-13H,1-3H3;1H/q+1;/p-1 |
| InChI Key | UJNFDSOJKNOBIA-UHFFFAOYSA-M |
| NACRES Code | NA.23 |
| UNSPSC | 12352103 |
| MSDS | msds/84884_1_29711_79_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluorodecylisocyanate | 142010-50-2 | 2A-9084866 |
| 2-(Ethoxycarbonyl)phenylisocyanate | 76393-16-3 | 2A-9084869 |
| 3-Ethoxycarbonylphenylisothiocyanate | 3137-84-6 | 2A-9084874 |
| 4-Ethoxyphenylisocyanate | 32459-62-4 | 2A-9084876 |
| 4-(Heptyloxy)phenylisocyanate | 55792-37-5 | 2A-9084883 |
| 1,3-Propanediisothiocyanate | 109704-32-7 | 2A-9084885 |
| Crotonylisothiocyanate | 60034-28-8 | 2A-9084886 |
| 1-Methoxy-prop-2-ylisothiocyanate | 362601-74-9 | 2A-9084887 |
| 6-Phenoxy-3-pyridinylisothiocyanate | 52024-70-1 | 2A-9084888 |
| 2,1,3-Benzothiadiazol-4-ylisothiocyanate | 109029-21-2 | 2A-9084889 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA