
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 614-31-3 |
| Catalog No. | 2A-9084880 |
| Chinese Name | 1-苄基-1-苯基肼 |
| Synonyms | 1-benzyl-1-phenylhydrazine; EINECS 210-377-5; MFCD00059186 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.26400 |
| Density | 1,1 g/cm3 |
| Boiling Point | 218 °C / 38mmHg |
| Melting Point | 164-166ºC |
| Appearance | Liquid;Light yellow to Brown clear liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2928000090 |
| SMILES | NN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2/c14-15(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10H,11,14H2 |
| InChI Key | SQMOOVFBFVTTGF-UHFFFAOYSA-N |
| MSDS | msds/84880_1_614_31_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Ethyl-1-phenylhydrazine | 644-21-3 | 2A-9084860 |
| 2-Isothiocyanato-benzoicacidethylester | 99960-09-5 | 2A-9084872 |
| 2,4,6-Trimethylphenylhydrazinehydrochloride | 76195-82-9 | 2A-9084875 |
| 1-(4-Isopropylphenyl)hydrazine | 63693-65-2 | 2A-9084877 |
| Ethyl4-isocyanatobenzoate | 30806-83-8 | 2A-9084879 |
| Ethyl3-isocyanatopropionate | 5100-34-5 | 2A-9084882 |
| 1-[3-(Tert-Butyl)phenyl]hydrazinehydrochloride | 306937-27-9 | 2A-9084894 |
| 1-(3-Propylphenyl)hydrazinehydrochloride | 306937-28-0 | 2A-9084895 |
| (4-Bromotrtrafluorophenyl)hydrazine | 2797-79-7 | 2A-9084897 |
| 4-Methoxy-2-methylphenylhydrazinehydrochloride | 93048-16-9 | 2A-9084898 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA