
CAS Number4657-93-6
Synonyms5-AMINOACENAPHTHENE; Acenaphthen-5-ylamin; 1,2-dihydro-5-amino-acenaphthene; 1,2-Dihydro-5-acenaphthylenamine; 5-Acenaphthenamine; ACENAPHTHEN-5-YLAMINE; Acenaphthen-5-amine; 5-Amino-acenaphthen; 1,2-dihydro-acenaphthylene-5-amine; 5-Acenaphtheneamine
Molecular FormulaC12H11N
Molecular Weight169.22200
Density1.233g/cm3
Boiling Point364.3ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4657-93-6 |
| Catalog No. | 2A-9084855 |
| Chinese Name | 1,2-二氢苊-5-胺 |
| Synonyms | 5-AMINOACENAPHTHENE; Acenaphthen-5-ylamin; 1,2-dihydro-5-amino-acenaphthene; 1,2-Dihydro-5-acenaphthylenamine; 5-Acenaphthenamine; ACENAPHTHEN-5-YLAMINE; Acenaphthen-5-amine; 5-Amino-acenaphthen; 1,2-dihydro-acenaphthylene-5-amine; 5-Acenaphtheneamine |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.22200 |
| Density | 1.233g/cm3 |
| Boiling Point | 364.3ºC at 760 mmHg |
| Storage Condition | Warehouse ventilation and low temperature drying |
| HTC | 2921499090 |
| SMILES | Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C12H11N/c13-11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-3,6-7H,4-5,13H2 |
| InChI Key | JEUAWMJVEYFVNJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 6-Benzoyl-2-naphthylphosphatesodiumsalt | 74144-43-7 | 2A-9084840 |
| 1-Butyl-4-diethoxymethyl-benzene | 83803-80-9 | 2A-9084844 |
| 2,2'-Thiodiacetamide | 14618-65-6 | 2A-9084849 |
| MethylL-2-isothiocyanato-3-methylbutyrate | 21055-41-4 | 2A-9084853 |
| MethylL-2-isothiocyanato-3-phenylpropionate | 21055-46-9 | 2A-9084854 |
| 1-(4-Chloro-2-methylphenyl)hydrazinehydrochloride | 19690-59-6 | 2A-9084856 |
| 1-(2,3-Dimethylphenyl)hydrazinehydrochloride | 56737-75-8 | 2A-9084857 |
| MethylL-2-isothiocyanato-4-(methylthio)butyrate | 21055-47-0 | 2A-9084858 |
| MethylL-2-isothiocyanato-4-methylvalerate | 21055-43-6 | 2A-9084859 |
| 1-Ethyl-1-phenylhydrazine | 644-21-3 | 2A-9084860 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA