
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 123191-00-4 |
| Catalog No. | 2A-9084730 |
| Chinese Name | 1-(三异丙基硅基)吲哚 |
| Synonyms | 1-(Triisopropylsilyl)-1H-indole; indol-1-yl-tri(propan-2-yl)silane |
| Molecular Formula | C17H26N1F1Si1 |
| Molecular Weight | 291.48 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 298.4±13.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Brown clear liquid |
| Storage Condition | room temperature |
| HTC | 2933990090 |
| MDL Number | MFCD20922722 |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1ccc2ccccc21 |
| InChI Key | YQGQSALLXQDVFW-UHFFFAOYSA-N |
| MSDS | msds/84730_1_123191_00_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 94.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 1-(Triisopropylsilyl)indole Modification number: 5 |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-(2,3-dimethyl-indol-1-yl)-3-[(furan-2-ylmethyl)-amino]-propan-2-ol | 436099-61-5 | 2A-9084723 |
| 2-(3-formyl-indol-1-yl)-N-furan-2-ylmethyl-acetamide | 347319-95-3 | 2A-9084725 |
| 1-isopropyl-1H-indole-2,3-dione | 10487-31-7 | 2A-9084726 |
| 2-(3-formyl-indol-1-yl)-N-(tetrahydro-furan-2-ylmethyl)-acetamide | 333750-65-5 | 2A-9084727 |
| 3-Bromo-1-(triisopropylsilyl)indole | 148249-36-9 | 2A-9084728 |
| 1-Isopropyl-1H-indole-3-carbaldehyde | 151409-84-6 | 2A-9084731 |
| Ethyl2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate | 72850-52-3 | 2A-9084733 |
| 4-(4-Chlorobenzenesulfonyl)-3-methylthiophene-2-carboxylicacid | 175137-65-2 | 2A-9084735 |
| 3-Methyl-5-methylsulfanyl-4-vinylthiophene-2-carboxylicacid | 175202-63-8 | 2A-9084741 |
| 2-Acetyl-5-Nitrothiophene | 39565-00-9 | 2A-9084749 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA