
CAS Number306935-54-6
Synonyms6-chloro-2H-1-benzopyran-3-carboxylic acid chloride; 6-chloro-2H-1-benzopyran-3-carbonyl chloride
Molecular FormulaC10H6Cl2O2
Molecular Weight391.82
Purity≥98 (HPLC)%
Density1.462g/cm3
Boiling Point348.9ºC at 760mmHg
Melting Point78-80ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 306935-54-6 |
| Catalog No. | 2A-9084638 |
| Chinese Name | 6-氯-2H-二苯并呋喃-3-羰酰氯 |
| Synonyms | 6-chloro-2H-1-benzopyran-3-carboxylic acid chloride; 6-chloro-2H-1-benzopyran-3-carbonyl chloride |
| Molecular Formula | C10H6Cl2O2 |
| Molecular Weight | 391.82 |
| Purity | ≥98 (HPLC) |
| Density | 1.462g/cm3 |
| Boiling Point | 348.9ºC at 760mmHg |
| Melting Point | 78-80ºC |
| Appearance | powder |
| HTC | 2916190090 |
| PubChem ID | 329825809 |
| MDL Number | MFCD00944458 |
| SMILES | CC(C1=CC=C2C([C@H](NC(C3=CC=C(F)C(Cl)=C3)=O)[C@H](O)C(C)(C)O2)=C1)=O |
| InChI | 1S/C20H19ClFNO4/c1-10(24)11-5-7-16-13(8-11)17(18(25)20(2,3)27-16)23-19(26)12-4-6-15(22)14(21)9-12/h4-9,17-18,25H,1-3H3,(H,23,26)/t17-,18-/m0/s1 |
| InChI Key | XLIIRNOPGJTBJD-ROUUACIJSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352202 |
| MSDS | msds/84638_1_306935_54_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Bromo-4-methyl-6-nitroaniline | 827-24-7 | 2A-9084628 |
| Carbazol-9-yl-aceticacid | 524-80-1 | 2A-9084629 |
| tris(4-Fluorophenyl)phosphine | 18437-78-0 | 2A-9084631 |
| 4-Carboxylicisatoicanhydride | 77423-14-1 | 2A-9084633 |
| Tropyliumtetrafluoroborate | 27081-10-3 | 2A-9084634 |
| 2-(Perfluoro-5-methylhexyl)ethylacrylate | 50836-65-2 | 2A-9084645 |
| 6-Chloro-2H-1,4-benzoxazin-3(4H)-one | 7652-29-1 | 2A-9084646 |
| 4-(9H-Fluoren-2-yl)-thiazol-2-yl-amine | 299438-56-5 | 2A-9084648 |
| 5,7-Dimethyl[1,8]naphthyridin-2-amine | 39565-07-6 | 2A-9084660 |
| Methyl5-methylthio-1,2,4-thiadiazol-3-ylcarbamate | 101848-19-5 | 2A-9084665 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA