
CAS Number2018-61-3
SynonymsN-Acetyl-3-phenyl-L-alanine; (2R)-2-acetamido-3-phenylpropanoic acid; N-Acetyl-D-phenylalanine; N-Acetyl-l-Phenylalanine; Acetyl-L-phenylalanine; (S)-2-Acetamido-3-phenylpropanoic acid; EINECS 217-959-8; N-acetyl-D,L-phenylalanine; (2S)-2-acetamido-3-phenylpropanoic acid; L-N-Acetylphenylalanine; MFCD00063158; Ac-Phe-OH; Acetyl-D-Phenylalanine; acetylphenylalanine; Ac-D-Phe-OH
Molecular FormulaC6H5CH2CH(NHCOCH3)CO2H
Molecular Weight207.23
Purity99%
Density1.2±0.1 g/cm3
Boiling Point453.9±38.0 °C at 760 mmHg
Melting Point171-173 °C (lit.)
Appearancepowder
EINECS217-959-8
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2018-61-3 |
| Catalog No. | 2A-9008462 |
| Chinese Name | N-乙酰-L-苯丙氨酸 |
| Synonyms | N-Acetyl-3-phenyl-L-alanine; (2R)-2-acetamido-3-phenylpropanoic acid; N-Acetyl-D-phenylalanine; N-Acetyl-l-Phenylalanine; Acetyl-L-phenylalanine; (S)-2-Acetamido-3-phenylpropanoic acid; EINECS 217-959-8; N-acetyl-D,L-phenylalanine; (2S)-2-acetamido-3-phenylpropanoic acid; L-N-Acetylphenylalanine; MFCD00063158; Ac-Phe-OH; Acetyl-D-Phenylalanine; acetylphenylalanine; Ac-D-Phe-OH |
| Molecular Formula | C6H5CH2CH(NHCOCH3)CO2H |
| Molecular Weight | 207.23 |
| Purity | 99 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 453.9±38.0 °C at 760 mmHg |
| Melting Point | 171-173 °C (lit.) |
| Appearance | powder |
| Storage Condition | 1. Keep the container sealed and stored in a cool, |
| EINECS | 217-959-8 |
| HTC | 2924299090 |
| PubChem ID | 24888445 |
| MDL Number | MFCD00063158 |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(O)=O |
| InChI | 1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m0/s1 |
| InChI Key | CBQJSKKFNMDLON-JTQLQIEISA-N |
| NACRES Code | NA.22 |
| eCl@ss | 32160406 |
| UNSPSC | 12352209 |
| Safety Description | S24/25 |
| MSDS | msds/8462_1_2018_61_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Nutritional Ingredients | ||
|---|---|---|
| Methyl benzoyl folate | 2A-108275 | 2A-9008275 |
| N-(4-Aminobenzoyl)-beta-alanine | 7377-08-4 | 2A-9008355 |
| N-(4-Nitrobenzoyl)-beta-alanine | 59642-21-6 | 2A-9008365 |
| N-Acetyl-D-glucosamine | 134451-94-8 | 2A-9008451 |
| N-Acetyl-L-glutamic acid | 1188-37-0 | 2A-9008461 |
| N-Acetyl-L-tryptophan | 1218-34-4 | 2A-9008464 |
| N-Acetyl-L-tyrosine | 537-55-3 | 2A-9008465 |
| N-alpha-Acetyl-glycine | 543-24-8 | 2A-9008467 |
| N-Butylsulfonyl-O-(4-(4-pyridinyl)butyl)-L-tyrosine | 149490-61-9 | 2A-9008517 |
| N-delta-Benzyloxycarbonyl-L-ornithine | 3304-51-6 | 2A-9008533 |
| Browse all Nutritional Ingredients products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA