
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 57802-79-6 |
| Catalog No. | 2A-9084497 |
| Chinese Name | 4-正丁基苄胺 |
| Synonyms | (4-butylphenyl)methanamine; MFCD02258855 |
| Molecular Formula | C11H17N1 |
| Molecular Weight | 163.26 |
| Density | 0,969 g/cm3 |
| Boiling Point | 89-91°C 1mm |
| Storage Condition | Store in a sealed container and keep in a cool, dr |
| Packaging | III |
| HTC | 2921499090 |
| MDL Number | MFCD02258855 |
| SMILES | CCCCc1ccc(CN)cc1 |
| InChI | InChI=1S/C11H17N/c1-2-3-4-10-5-7-11(9-12)8-6-10/h5-8H,2-4,9,12H2,1H3/p+1 |
| InChI Key | IBVGSPOHLFKLHM-UHFFFAOYSA-N |
| Hazard Symbols | 8 |
| MSDS | msds/84497_1_57802_79_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one | 5381-99-7 | 2A-9084491 |
| 4-Chlorobenzil | 22711-23-5 | 2A-9084492 |
| 3,4-Difluorobenzamide | 85118-04-3 | 2A-9084494 |
| 4-Biphenylcarboxamide | 3815-20-1 | 2A-9084495 |
| 4-N-Butylbenzamide | 107377-07-1 | 2A-9084496 |
| 1,2-Bis(diphenylphosphino)benzene | 13991-08-7 | 2A-9084501 |
| 4-Biphenylsulfonylchloride | 1623-93-4 | 2A-9084506 |
| Benzylphosphonicacid | 6881-57-8 | 2A-9084507 |
| 3-N-Propyl-2-pyrazolin-5-one | 29211-70-9 | 2A-9084508 |
| (E)-3-(5-Iodo-2-furyl)prop-2-enoicacid | 306936-43-6 | 2A-9084509 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA