
CAS Number4958-56-9
SynonymsBenzophenone,2-methylamino-5-nitro; 2-Methylaminomethyl-5-nitrobenzophenone; [2-(Methylamino)-5-nitrophenyl](phenyl)methanone; Methanone,[2-(methylamino)-5-nitrophenyl]phenyl
Molecular FormulaC14H12N2O3
Molecular Weight256.263
Density1.288 g/cm3
Boiling Point471ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4958-56-9 |
| Catalog No. | 2A-9084463 |
| Chinese Name | 2-甲氨-5-硝基二苯甲酮 |
| Synonyms | Benzophenone,2-methylamino-5-nitro; 2-Methylaminomethyl-5-nitrobenzophenone; [2-(Methylamino)-5-nitrophenyl](phenyl)methanone; Methanone,[2-(methylamino)-5-nitrophenyl]phenyl |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.263 |
| Density | 1.288 g/cm3 |
| Boiling Point | 471ºC at 760 mmHg |
| HTC | 2922399090 |
| MDL Number | MFCD00007258 |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O3/c1-15-13-8-7-11(16(18)19)9-12(13)14(17)10-5-3-2-4-6-10/h2-9,15H,1H3 |
| InChI Key | KIWZKBUUWJTGPP-UHFFFAOYSA-N |
| MSDS | msds/84463_1_4958_56_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,6-Dimethyl-2-nitroaniline | 1635-84-3 | 2A-9084442 |
| 1-[1-(4-Chloropyenyl)cyclobutyl]-3-Methylbutylamine | 84467-54-9 | 2A-9084450 |
| 4-Methyl-2-nitro-acetanilide | 29111-73-7 | 2A-9084454 |
| Ethylenediaminetetraaceticdianhydride | 23911-25-3 | 2A-9084457 |
| 2-Acetamido-N-(E-Aminocarproyl)-2-deoxy-beta-D-glucopyranosylamine | 112898-10-9 | 2A-9084461 |
| Methyl5-methyl-2-furoate | 2527-96-0 | 2A-9084464 |
| 4-Acetamido-9-fluorenone | 42135-35-3 | 2A-9084479 |
| 3-Chloro-3H-2,1-benzoxathiole-1,1-dioxide | 25595-59-9 | 2A-9084481 |
| N-Acetyl-4-benzoquinoneimine | 50700-49-7 | 2A-9084484 |
| 5-Iso-Butyl-5-methylhydantoin | 27886-67-5 | 2A-9084487 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA