
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84-95-7 |
| Catalog No. | 2A-9084361 |
| Chinese Name | N,N'-二乙基-1-萘胺 |
| Synonyms | 1-Diaethylamino-naphthalin; MFCD00046389; N,N-diethyl naphthalen-1-yl-amine; N,N-Diethyl-1-naphthylamine; N,N-Diethyl-1-aminonaphthalene; EINECS 201-576-8 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.373 |
| Density | 1.01 |
| Boiling Point | 285 °C |
| Storage Condition | This product should be sealed and stored in a cool |
| HTC | 2921450090 |
| MDL Number | MFCD00154654 |
| SMILES | CCN(CC)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H17N/c1-3-15(4-2)14-11-7-9-12-8-5-6-10-13(12)14/h5-11H,3-4H2,1-2H3 |
| InChI Key | XLEMRIJDZGESRG-UHFFFAOYSA-N |
| MSDS | msds/84361_1_84_95_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2921450090 1-naphthylamine (α-naphthylamine), 2-naphthylamine (β-naphthylamine) and their derivatives; salts thereof. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| (+/-)-2-Amino-6,7-dihydroxy-1,2,3,4-tetrahydronaphthaleneHBr | 73304-33-3 | 2A-9084354 |
| Bov-Phe(3,5-Dii,4-NH2)-OH | 67230-47-1 | 2A-9084355 |
| Diethylbenzamidomalonate | 16798-45-1 | 2A-9084356 |
| N-(4-Chloro-2-methylphenyl)-3-(phosphonooxy)naphthalene-2-carboxamide | 2616-72-0 | 2A-9084359 |
| 1-(4-[Phenylazo]phenylazo)-2-methylaminonaphthalene | 125455-63-2 | 2A-9084360 |
| Naphthalene-2-sulfonamide | 1576-47-2 | 2A-9084362 |
| 8-(2-Aminoethylamino)-1-naphthalenesulfonicacid | 50402-57-8 | 2A-9084363 |
| N-(4-Aminobutyl)-5-chloro-2-naphthalenesulfonamideHCl | 88519-57-7 | 2A-9084364 |
| N-(6-Aminohexyl)-1-naphthalenesulfonamideHCl | 61714-25-8 | 2A-9084365 |
| N-(4-Aminobutyl)-2-naphthalenesulfonamideHCl | 89108-46-3 | 2A-9084368 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA