
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83-64-7 |
| Catalog No. | 2A-9084340 |
| Chinese Name | 8-氨基-1-萘酚-5-磺酸 |
| Synonyms | 4-amino-5-hydroxynaphthalene-1-sulfonic acid; EINECS 201-491-6; MFCD00003992 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 341.29 |
| Melting Point | >380 °C |
| Appearance | powder |
| Storage Condition | This product should be sealed and stored away from |
| HTC | 2922299090 |
| MDL Number | MFCD00036444 |
| SMILES | [Na+].[S](=O)(=O)(O)c1cc2c(c(c1)N)c(cc(c2)[S](=O)(=O)O)[O-] |
| InChI | 1S/C10H9NO7S2.Na/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8;/h1-4,12H,11H2,(H,13,14,15)(H,16,17,18);/q;+1/p-1 |
| InChI Key | QPILZZVXGUNELN-UHFFFAOYSA-M |
| NACRES Code | NA.22 |
| UNSPSC | 12352107 |
| MSDS | msds/84340_1_83_64_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 90.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-monoacetyl-4,4'-diaminodiphenylsulfone | 565-20-8 | 2A-9084328 |
| 1,1-Diethyldiethylenetriamine | 24426-16-2 | 2A-9084329 |
| 3,4-Diaminobenzophenonemonohydrochloride | 57070-71-0 | 2A-9084331 |
| 2-Amino-4-chloro-2'-fluorobenzophenone | 203303-05-3 | 2A-9084332 |
| 1-Dimethylaminophthalene-5-sulphonylhydrazine | 33008-06-9 | 2A-9084339 |
| 5-Dimethylamino-1-naphthalenesulfonamide | 1431-39-6 | 2A-9084341 |
| 4-Amino-5-hydroxy-3-(4-nitrophenylazo)-2,7-naphthalenedisulfonicaciddisodiumsalt | 56431-61-9 | 2A-9084342 |
| 1-Amino-4-chloronaphthalene | 4684-12-2 | 2A-9084343 |
| 2-(p-Toluidino)naphthalene-6-sulfonicacidpotassiumsalt | 32752-10-6 | 2A-9084344 |
| 3-Amino-2-hydroxynaphthalene | 5417-63-0 | 2A-9084345 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA