CAS Number1123-63-3
Synonyms4-Chloro-2,6-xylenol; 4-Chlor-2,6-dimethyl-phenol; p-chloro-vic-m-2-xylenol; MFCD00020138; Phenol,4-chloro-2,6-dimethyl; 2,6-dimethyl-4-chlorophenol; 4-chloro-2,6-dimethyl-phenol; 5-Chlor-2-hydroxy-m-xylol; EINECS 214-376-0
Molecular FormulaC8H9O1Cl1
Molecular Weight156.61
Density1.183 g/cm3
Boiling Point241.6ºC at 760 mmHg
Melting Point80-85 °C
AppearanceWhite to off-white crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1123-63-3 |
| Catalog No. | 2A-9084280 |
| Chinese Name | 4-氯-2,6-二甲基苯酚 |
| Synonyms | 4-Chloro-2,6-xylenol; 4-Chlor-2,6-dimethyl-phenol; p-chloro-vic-m-2-xylenol; MFCD00020138; Phenol,4-chloro-2,6-dimethyl; 2,6-dimethyl-4-chlorophenol; 4-chloro-2,6-dimethyl-phenol; 5-Chlor-2-hydroxy-m-xylol; EINECS 214-376-0 |
| Molecular Formula | C8H9O1Cl1 |
| Molecular Weight | 156.61 |
| Density | 1.183 g/cm3 |
| Boiling Point | 241.6ºC at 760 mmHg |
| Melting Point | 80-85 °C |
| Appearance | White to off-white crystalline powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2908199090 |
| MDL Number | MFCD00020138 |
| SMILES | Cc1cc(Cl)cc(C)c1O |
| InChI | InChI=1S/C8H9ClO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
| InChI Key | VWYKSJIPZHRLNO-UHFFFAOYSA-N |
| MSDS | msds/84280_1_1123_63_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5-Chloro-4-methyl-2-nitroaniline | 7149-80-6 | 2A-9084273 |
| 5-Chloro-2-methoxybenzenesulfonylchloride | 22952-32-5 | 2A-9084274 |
| 1-(2,5-Dimethoxyphenyl)-2-thiourea | 67617-98-5 | 2A-9084276 |
| 2-Chloro-6-fluoro-omega-nitrostyrene | 116272-78-7 | 2A-9084277 |
| 2,3-Dimethoxythiobenzamide | 145736-64-7 | 2A-9084278 |
| 2,5-Dimethoxythiobenzamide | 351065-79-7 | 2A-9084281 |
| 4-Chloro-2,6-dimethylanilinehydrochloride | 5769-32-4 | 2A-9084282 |
| 3,4-Dimethoxythiobenzamide | 58952-14-0 | 2A-9084283 |
| 3,5-Dimethoxythiobenzamide | 114980-23-3 | 2A-9084285 |
| alpha-Allyl-L-Ala | 16820-25-0 | 2A-9084286 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS