
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 205748-03-4 |
| Catalog No. | 2A-9084254 |
| Chinese Name | 4'-(4-硝基苄氧基)苯乙酮 |
| Synonyms | MFCD00075690; HMS547A11 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Density | 1.247g/cm3 |
| Boiling Point | 456.3ºC at 760 mmHg |
| Melting Point | 129-131ºC |
| Storage Condition | Storage method: dry, cool, airtight place |
| HTC | 2914700090 |
| SMILES | CC(=O)c1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H13NO4/c1-11(17)13-4-8-15(9-5-13)20-10-12-2-6-14(7-3-12)16(18)19/h2-9H,10H2,1H3 |
| InChI Key | GUBOWULDVFKCRF-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3,6-Di-tert-Butylfluorene | 58775-07-8 | 2A-9084246 |
| 4-Acetamidobenzoylchloride | 16331-48-9 | 2A-9084247 |
| 3,5-Dimethoxy-4-hydroxyphenethylaminehydrochloride | 2176-14-9 | 2A-9084250 |
| 4-Acetamido-3-chlorobenzenesulfonylchloride | 16761-18-5 | 2A-9084251 |
| 4,4'-Di-tert-Butyldiphenylmethane | 19099-48-0 | 2A-9084253 |
| Diazabenzi[k]fluoranthene | 207-11-4 | 2A-9084255 |
| Dibromomalonamide | 73003-80-2 | 2A-9084256 |
| 4,4'-Dibromobenzil | 35578-47-3 | 2A-9084259 |
| 1,2-Dianilinoethane | 150-61-8 | 2A-9084260 |
| 2,3-Dimethoxyphenethylamine | 3213-29-4 | 2A-9084261 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA