
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5814-06-2 |
| Catalog No. | 2A-9084238 |
| Chinese Name | 2,4-二氯苯甲酰肼 |
| Synonyms | MFCD00025113; 2,4-dichlorobenzohydrazide |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.045 |
| Density | 1.455 g/cm3 |
| Melting Point | 168-170°C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2928000090 |
| MDL Number | MFCD00025113 |
| SMILES | NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H6Cl2N2O/c8-4-1-2-5(6(9)3-4)7(12)11-10/h1-3H,10H2,(H,11,12) |
| InChI Key | QOJQHOGSXXSMKX-UHFFFAOYSA-N |
| MSDS | msds/84238_1_5814_06_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4,5-Trihydroxybenzaldehyde | 35904-87-2 | 2A-9084001 |
| N1-(2,6-Dichloro-4-pyridyl)-2-(2,4-difluorophenyl)hydrazine-1-carboxamide | 286436-18-8 | 2A-9084160 |
| 2,4,5-Triethoxybenzophenone | 52199-46-9 | 2A-9084167 |
| 2,4-Dichloro-5-methylbenzenesulfonylchloride | 28286-86-4 | 2A-9084227 |
| 2,4-Dichloro-6-methylaniline | 30273-00-8 | 2A-9084228 |
| N,N'-Octamethylenebis(Dichloroacetamide) | 1477-57-2 | 2A-9084241 |
| (2,4-Dinitrophenyl)hydrazone2-propanone | 1567-89-1 | 2A-9084244 |
| 2,4-Dinitrobenzenesulfonylchloride | 1656-44-6 | 2A-9084249 |
| 1-(2,4-Dimethoxyphenyl)-2-thiourea | 35696-77-6 | 2A-9084275 |
| 2,4-Dimethoxythiobenzamide | 23822-07-3 | 2A-9084279 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA