
CAS Number30216-44-5
Synonymso-bromobenzylthioamide; MFCD04973314; 2-Bromobenzothioamide; 2-bromobenzene-1-carbothioamide; Thiobenzamide,2-bromo; 2-Bromothiobenzamide; 2-Bromthiobenzamid; m-bromo-thiobenzamide
Molecular FormulaC7H6BrNS
Molecular Weight216.09800
Density1.634g/cm3
Boiling Point307ºC at 760mmHg
Melting Point83ºC
AppearanceWhite, beige to yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 30216-44-5 |
| Catalog No. | 2A-9084207 |
| Chinese Name | 2-溴硫代苯甲酰胺 |
| Synonyms | o-bromobenzylthioamide; MFCD04973314; 2-Bromobenzothioamide; 2-bromobenzene-1-carbothioamide; Thiobenzamide,2-bromo; 2-Bromothiobenzamide; 2-Bromthiobenzamid; m-bromo-thiobenzamide |
| Molecular Formula | C7H6BrNS |
| Molecular Weight | 216.09800 |
| Density | 1.634g/cm3 |
| Boiling Point | 307ºC at 760mmHg |
| Melting Point | 83ºC |
| Appearance | White, beige to yellow powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2930909090 |
| SMILES | NC(=S)c1ccccc1Br |
| InChI | InChI=1S/C7H6BrNS/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10) |
| InChI Key | GHCQWSAFBXLYSO-UHFFFAOYSA-N |
| MSDS | msds/84207_2_30216_44_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2930909090. other organo-sulfur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Ethylnaphthalene | 939-27-5 | 2A-9084190 |
| Benzophenoneazine | 983-79-9 | 2A-9084192 |
| Pramoxine | 2A-168401 | 2A-9084197 |
| 1-(2-Bromophenyl)-2-thiourea | 5391-30-0 | 2A-9084205 |
| 1-(4-Bromophenyl)-2-thiourea | 2646-30-2 | 2A-9084206 |
| 3-Bromothiobenzamide | 2227-62-5 | 2A-9084208 |
| 2-Methyl-1-phenyl-propylamine | 6668-27-5 | 2A-9084209 |
| L-ThreonineamideHCl | 33209-01-7 | 2A-9084210 |
| L-ThreonineMethylesterHCl | 71989-43-0 | 2A-9084211 |
| 4-n-Butylphenylhydrazinehydrochloride | 64287-11-2 | 2A-9084215 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA