![N-[2-Amino-4-(trifluoromethyl)phenyl]piperidine structure, CAS 1496-40-8](/structures/20000/8412_1_1496_40_8.png)
CAS Number1496-40-8
Synonyms3-AMINO-4-(1-PIPERIDINO)BENZOTRIFLUORIDE; 2-piperidin-1-yl-5-trifluoromethyl-aniline; MFCD00042161; 2-piperidin-1-yl-5-(trifluoromethyl)aniline; 2-(piperidin-1-yl)-5-(trifluoromethyl)benzenamine; 2-piperidine-1-yl-5-trifluoromethyl-phenylamine; 2-(1-Piperidinyl)-5-(trifluoromethyl)aniline; 2-(piperidin-1-yl)-5-(trifluoromethyl)aniline; 2-piperidino-5-(trifluoromethyl)aniline; N-<2-Amino-4-trifluormethyl-phenyl>-piperidin; AKOS BB-8562; 3-AMINO-4-PIPERIDINOBENZOTRIFLUORIDE
Molecular FormulaC12H15N2F3
Molecular Weight244.26
Purity97%
Density1.2±0.1 g/cm3
Boiling Point332.2±42.0 °C at 760 mmHg
Melting Point41 °C
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1496-40-8 |
| Catalog No. | 2A-9008412 |
| Chinese Name | 2-哌啶-1-基-5-(三氟甲基)苯胺 |
| Synonyms | 3-AMINO-4-(1-PIPERIDINO)BENZOTRIFLUORIDE; 2-piperidin-1-yl-5-trifluoromethyl-aniline; MFCD00042161; 2-piperidin-1-yl-5-(trifluoromethyl)aniline; 2-(piperidin-1-yl)-5-(trifluoromethyl)benzenamine; 2-piperidine-1-yl-5-trifluoromethyl-phenylamine; 2-(1-Piperidinyl)-5-(trifluoromethyl)aniline; 2-(piperidin-1-yl)-5-(trifluoromethyl)aniline; 2-piperidino-5-(trifluoromethyl)aniline; N-<2-Amino-4-trifluormethyl-phenyl>-piperidin; AKOS BB-8562; 3-AMINO-4-PIPERIDINOBENZOTRIFLUORIDE |
| Molecular Formula | C12H15N2F3 |
| Molecular Weight | 244.26 |
| Purity | 97 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 332.2±42.0 °C at 760 mmHg |
| Melting Point | 41 °C |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2933399090 |
| MDL Number | MFCD00042161 |
| SMILES | Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| InChI Key | BERRRZOJDANPHE-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/8412_1_1496_40_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| N,N-Carbonyldiimidazole | 530-62-1 | 2A-9008385 |
| N,N-Dimethylamide carbonylmethyl piperazine | 39890-43-2 | 2A-9008398 |
| N-[(1,4-Benzodioxan-2-yl)carbonyl]piperazine | 70918-00-2 | 2A-9008406 |
| N-[(1,4-Benzodioxane-2-yl)carboxyl] piperazine hydrochloride | 70918-74-0 | 2A-9008407 |
| N-[2-Amino-4-(trifluoromethyl)phenyl]morpholine | 784-57-6 | 2A-9008411 |
| N-[2-Amino-4-trifluoromethylphenyl]pyrrolidine | 133184-80-2 | 2A-9008413 |
| N-2-Aminoethyl homopiperidine | 51388-00-2 | 2A-9008431 |
| N-Acetyl-4-(4-hydroxyphenyl)piperazine | 67914-60-7 | 2A-9008449 |
| N-Acetyl-5-bromo-3-hydroxyindole | 114165-30-9 | 2A-9008450 |
| N-Acetylindole-3-carboxaldehyde | 22948-94-3 | 2A-9008460 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA