
CAS Number270065-80-0
Synonyms(3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-[4-(trifluoromethyl)phenyl]butanoic acid; MFCD01861070; boc-(s)-3-amino-4-(4-trifluoromethyl-phenyl)-butyric acid
Molecular FormulaC16H20F3NO4
Molecular Weight347.329
Density1.2±0.1 g/cm3
Boiling Point449.7±45.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 270065-80-0 |
| Catalog No. | 2A-9084106 |
| Chinese Name | BOC-(S)-3-氨基-4-(4-三氟甲苯基)-丁酸 |
| Synonyms | (3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-[4-(trifluoromethyl)phenyl]butanoic acid; MFCD01861070; boc-(s)-3-amino-4-(4-trifluoromethyl-phenyl)-butyric acid |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.329 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 449.7±45.0 °C at 760 mmHg |
| Storage Condition | Store in a sealed container filled with inert gas |
| HTC | 2924299090 |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccc(C(F)(F)F)cc1 |
| InChI Key | UKFKHDUXBBWVHB-LBPRGKRZSA-N |
| MSDS | msds/84106_1_270065_80_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| Fmoc-(S)-3-Amino-4-(3,4-difluorophenyl)butanoicacid | 270063-55-3 | 2A-9084100 |
| Boc-(S)-3-Amino-4-(2-trifluoromethylphenyl)butanoicacid | 270065-74-2 | 2A-9084101 |
| Fmoc-(S)-3-Amino-4-(2-trifluoromethylphenyl)butanoicacid | 270065-75-3 | 2A-9084102 |
| Boc-(S)-3-Amino-4-(3-trifluoromethylphenyl)butanoicacid | 270065-77-5 | 2A-9084103 |
| Fmoc-(S)-3-Amino-4-(3-trifluoromethylphenyl)butanoicacid | 270065-78-6 | 2A-9084104 |
| Fmoc-(S)-3-Amino-4-(4-trifluoromethylphenyl)butanoicacid | 270065-81-1 | 2A-9084107 |
| 2-Fluorophenylisocyanate | 16744-98-2 | 2A-9084123 |
| 2,6-Difluorophenylisocyanate | 65295-69-4 | 2A-9084124 |
| 2-Chloro-4-(trifluoromethylthio)phenylisocyanate | 55225-89-3 | 2A-9084125 |
| 3-Chloro-4-(difluoromethoxy)phenylisocyanate | 39479-97-5 | 2A-9084126 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA