
CAS Number33342-30-2
Synonyms5-(4-nitrophenyl)-2-furylmethanol; 5-(4-nitrophenyl)furfuryl alcohol; [5-(4-Nitro-phenyl)-furan-2-yl]-methanol; 2-Hydroxymethyl-5-(4-nitrophenyl)-furan; [5-(4-nitrophenyl)-2-furyl]methan-1-ol; 5-(p-Nitrophenyl)furfuryl alcohol; MFCD00239351
Molecular FormulaC11H9NO4
Molecular Weight233.18
Purity96%
Density1.343g/cm3
Boiling Point384.8ºC at 760 mmHg
Melting Point255-257 °C (dec.) (lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33342-30-2 |
| Catalog No. | 2A-9083981 |
| Chinese Name | 5-(4-硝基苯基)呋喃乙醇 |
| Synonyms | 5-(4-nitrophenyl)-2-furylmethanol; 5-(4-nitrophenyl)furfuryl alcohol; [5-(4-Nitro-phenyl)-furan-2-yl]-methanol; 2-Hydroxymethyl-5-(4-nitrophenyl)-furan; [5-(4-nitrophenyl)-2-furyl]methan-1-ol; 5-(p-Nitrophenyl)furfuryl alcohol; MFCD00239351 |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 233.18 |
| Purity | 96 |
| Density | 1.343g/cm3 |
| Boiling Point | 384.8ºC at 760 mmHg |
| Melting Point | 255-257 °C (dec.) (lit.) |
| Storage Condition | Store in an airtight, cool and dry place, ensuring |
| HTC | 2932190090 |
| PubChem ID | 24866498 |
| MDL Number | MFCD00094261 |
| SMILES | OC(=O)c1ccc(o1)-c2ccc(cc2)[N+]([O-])=O |
| InChI | 1S/C11H7NO5/c13-11(14)10-6-5-9(17-10)7-1-3-8(4-2-7)12(15)16/h1-6H,(H,13,14) |
| InChI Key | FXZTYDPWMQBTDH-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/83981_1_33342_30_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,7-Dimethoxy-5-(2-propanyl)-1,3-benzodioxole | 523-80-8 | 2A-9083957 |
| 4-(4-Fluorobenzyloxy)-3-nitroacetophenone | 175136-24-0 | 2A-9083958 |
| 4-Nitrofluorescein | 3326-35-0 | 2A-9083962 |
| 5-(4-chlorophenyl)-2-furoicacid | 41019-45-8 | 2A-9083975 |
| 5-(4-Methylphenyl)-2-furoicacid | 52938-98-4 | 2A-9083977 |
| 5-Methylfurmethiodide | 1197-60-0 | 2A-9083995 |
| 5-Nitro-2-furoylchloride | 25084-14-4 | 2A-9084009 |
| 5-Nitrofluorescein | 27402-68-2 | 2A-9084010 |
| 6-Chloro-3-formyl-7-methylchromone | 64481-12-5 | 2A-9084014 |
| 7-Chloro-2H-1,4-benzothiazin-3(4H)-one | 5333-05-1 | 2A-9084015 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA