
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70028-88-5 |
| Catalog No. | 2A-9083916 |
| Chinese Name | 3,4,5-三氟苯甲酮 |
| Synonyms | MFCD00083525; phenyl(3,4,5-trifluorophenyl)methanone; 3,4,5-Trifluorobenzophenone; phenyl 3,4,5-trifluorophenyl ketone |
| Molecular Formula | C13H7O1F3 |
| Molecular Weight | 236.19 |
| Density | 1.31g/cm3 |
| Boiling Point | 320.2ºC at 760 mmHg |
| Melting Point | 161-165 °C(lit.) |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2914700090 |
| MDL Number | MFCD00083525 |
| SMILES | O=C(c1ccccc1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H7F3O/c14-10-6-9(7-11(15)12(10)16)13(17)8-4-2-1-3-5-8/h1-7H |
| InChI Key | BTQOMZVQASIULU-UHFFFAOYSA-N |
| MSDS | msds/83916_1_70028_88_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3-Methoxy-4-formyl)phenoxybutyricacid | 309964-23-6 | 2A-9083883 |
| Ethyl2-furoate | 614-98-2 | 2A-9083885 |
| 4-Chloro-4'-formyldiphenylether | 61343-99-5 | 2A-9083892 |
| 2,3'-Difluorobenzophenone | 58139-11-0 | 2A-9083911 |
| 1-Oxa-2-oxo-3-thiaindoliziniumchloride | 89025-51-4 | 2A-9083915 |
| 2,6-Difluoro-4'-methylbenzophenone | 122041-25-2 | 2A-9083923 |
| 2-Fluoro-4'-(2-phenoxyethoxy)benzophenone | 216143-97-4 | 2A-9083926 |
| 2-Fluoro-4'-hydroxybenzophenone | 101969-75-9 | 2A-9083927 |
| 2-chloro-N-(2-furylmethyl)acetamide | 40914-13-4 | 2A-9083930 |
| Potassium4-fluorophenyltrifluoroborate | 192863-35-7 | 2A-9083934 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA