CAS Number35450-36-3
Synonyms2-Bromo-5-methoxybenzoic Acid Methyl Ester; Methyl 2-bromo-5-methoxybenzoate; MFCD00051594; 2-Bromo-5-methoxy benzoic acid methyl ester; 2-bromo-5-methoxy methylbenzoate; Benzoic acid, 2-bromo-5-methoxy-, methyl ester; 6-Bromo-m-anisic Acid Methyl Ester; Methyl 6-Bromo-m-anisate; methyl-2-bromo-5-methoxybenzoate
Molecular FormulaBrC6H3(OCH3)CO2CH3
Molecular Weight245.07
Purity97%
Density1.5±0.1 g/cm3
Boiling Point271 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35450-36-3 |
| Catalog No. | 2A-9083847 |
| Chinese Name | 2-溴-5-甲氧基苯甲酸甲酯 |
| Synonyms | 2-Bromo-5-methoxybenzoic Acid Methyl Ester; Methyl 2-bromo-5-methoxybenzoate; MFCD00051594; 2-Bromo-5-methoxy benzoic acid methyl ester; 2-bromo-5-methoxy methylbenzoate; Benzoic acid, 2-bromo-5-methoxy-, methyl ester; 6-Bromo-m-anisic Acid Methyl Ester; Methyl 6-Bromo-m-anisate; methyl-2-bromo-5-methoxybenzoate |
| Molecular Formula | BrC6H3(OCH3)CO2CH3 |
| Molecular Weight | 245.07 |
| Purity | 97 |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 271 °C |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2916399090 |
| PubChem ID | 24884412 |
| MDL Number | MFCD00051594 |
| SMILES | COC(=O)c1cc(OC)ccc1Br |
| InChI | 1S/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
| InChI Key | VRTQLDFCPNVQNT-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/83847_1_35450_36_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Beta-Acetoxy-5-etiocholenicacid | 51424-66-9 | 2A-9083835 |
| (1R)-10-Camphorsulfonamide | 72597-34-3 | 2A-9083840 |
| Acetoxylithocholicacid | 4057-84-5 | 2A-9083844 |
| 7-Fluorobenzofurazan-4-sulfonicacidammoniumsalt | 84806-27-9 | 2A-9083845 |
| Tetrabutylammoniumfluoridehydrate | 22206-57-1 | 2A-9083846 |
| Methylpentafluorobenzoate | 36629-42-2 | 2A-9083849 |
| 3-Borono-4-fluorobenzoicacidethylester | 874219-60-0 | 2A-9083854 |
| 2,3,4,5,6-Pentafluorobenzophenone | 1536-23-8 | 2A-9083858 |
| Tetra-N-hexylammoniumbromide | 4328-13-6 | 2A-9083859 |
| Sarcosineanhydride | 5076-82-4 | 2A-9083860 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS