
CAS Number54381-16-7
SynonymsN,N Bis Hydroxyethyl PPD sulfate; EINECS 259-134-5; 2-[(4-aminophenyl)(2-hydroxyethyl)amino]ethanol sulphate; N,N-Bis(hydroxyethyl)-p-phenylenediamine sulfate; 2,2'-[(4-aminophenyl)imino]bis-ethano sulfate; 2,2'-[(4-Aminophenyl)imino]bisethanol sulfate; MFCD08062584; N4,N4-bishydroxyethyl-p-phenylenediamine sulfate; Rodol Gray HED; Rodol Grey HED; N,N-DI(2,2-ETHOXYL)-P-PHENYLENEDIAMINE SULFATE; JAROCOL BHP
Molecular FormulaC10H18N2O6S
Molecular Weight294.32
Purity98%
Boiling Point416.4ºC at 760 mmHg
Melting Point168-171°C
Appearancewhite crystal powder
EINECS259-134-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54381-16-7 |
| Catalog No. | 2A-9008382 |
| Chinese Name | N,N-双(2-羟乙基)-对苯二胺硫酸盐 |
| Synonyms | N,N Bis Hydroxyethyl PPD sulfate; EINECS 259-134-5; 2-[(4-aminophenyl)(2-hydroxyethyl)amino]ethanol sulphate; N,N-Bis(hydroxyethyl)-p-phenylenediamine sulfate; 2,2'-[(4-aminophenyl)imino]bis-ethano sulfate; 2,2'-[(4-Aminophenyl)imino]bisethanol sulfate; MFCD08062584; N4,N4-bishydroxyethyl-p-phenylenediamine sulfate; Rodol Gray HED; Rodol Grey HED; N,N-DI(2,2-ETHOXYL)-P-PHENYLENEDIAMINE SULFATE; JAROCOL BHP |
| Molecular Formula | C10H18N2O6S |
| Molecular Weight | 294.32 |
| Purity | 98 |
| Boiling Point | 416.4ºC at 760 mmHg |
| Melting Point | 168-171°C |
| Appearance | white crystal powder |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| EINECS | 259-134-5 |
| HTC | 2922199090 |
| MDL Number | MFCD00013177 |
| SMILES | [S](=O)(=O)([O-])[O-].[N+H](CCO)(CCO)c1ccc(cc1)[N+H3] |
| InChI | InChI=1S/C10H16N2O2.H2O4S/c11-9-1-3-10(4-2-9)12(5-7-13)6-8-14;1-5(2,3)4/h1-4,13-14H,5-8,11H2;(H2,1,2,3,4) |
| InChI Key | KMCFMEHSEWDYKG-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352116 |
| MSDS | msds/8382_1_54381_16_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N,6-Dimethyl-4-methoxy-1,3,5-triazin-2-ylamine | 5248-39-5 | 2A-9008375 |
| N,N,N',N'-Tetrabutylurea | 4559-86-8 | 2A-9008377 |
| N,N,N',N'-Tetramethyl-1,3-propanediamine | 110-95-2 | 2A-9008378 |
| N,N'-Bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-nitro-1,3-benzenedicarboxamide | 76820-34-3 | 2A-9008379 |
| N,N-Bis(2-chloro-6-fluorobenzyl)hydroxylamine | 175136-75-1 | 2A-9008381 |
| N,N'-Bis(2-hydroxyethyl)-2-nitro-4-phenylenediamine | 84041-77-0 | 2A-9008383 |
| N,N'-Bis(pentafluorophenyl)urea | 21132-30-9 | 2A-9008384 |
| N,N-Dibenzyl ethylenediamine dicetic acid | 122-75-8 | 2A-9008386 |
| N,N'-Dibenzylethylenediamine | 140-28-3 | 2A-9008387 |
| N,N-Dibenzylethylenediamine | 14165-27-6 | 2A-9008388 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA