
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 97888-80-7 |
| Catalog No. | 2A-9083736 |
| Chinese Name | 4-(苄氧基)-3,5-二甲基苯甲酸 |
| Synonyms | 3,5-dimethyl-4-phenylmethoxybenzoic acid; MFCD00272572 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.3 |
| Density | 1.169g/cm3 |
| Boiling Point | 408.6ºC at 760mmHg |
| Melting Point | 159-162°C |
| Appearance | light brown solid |
| Storage Condition | Store airtight in a cool, dry warehouse. Keep away |
| HTC | 2918990090 |
| MDL Number | MFCD00272572 |
| SMILES | Cc1cc(C(=O)O)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C16H16O3/c1-11-8-14(16(17)18)9-12(2)15(11)19-10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,17,18)/p-1 |
| InChI Key | JABUPJCJZZNUFK-UHFFFAOYSA-N |
| MSDS | msds/83736_1_97888_80_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-5-iodobenzotrifluoride | 97760-97-9 | 2A-9083731 |
| Ractopaminehydrochloride | 97825-25-7 | 2A-9083732 |
| Pentamethylbenzenesulfonylchloride | 52499-94-2 | 2A-9083733 |
| 3-Phenoxyaniline | 3586-12-7 | 2A-9083734 |
| Naphtalene-1,4-dipropionicaciddisodiumsalt | 97860-58-7 | 2A-9083735 |
| 3-Chloro-2-Methylpyridin-4-amine | 97944-40-6 | 2A-9083737 |
| 3-Bromo-5-Methylpyridin-4-amine | 97944-43-9 | 2A-9083738 |
| 2-Phenoxynicotinonitrile | 14178-15-5 | 2A-9083739 |
| 4-Phenylazodiphenylamine | 101-75-7 | 2A-9083740 |
| 1-(Phenylethynyl)-1-cyclohexanol | 20109-09-5 | 2A-9083741 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA