
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55502-53-9 |
| Catalog No. | 2A-9083730 |
| Chinese Name | (五氟苯氧基)乙酰氯 |
| Synonyms | 2-(2,3,4,5,6-pentafluorophenoxy)acetyl chloride; MFCD01320685; EINECS 259-676-2 |
| Molecular Formula | C8H2ClF5O2 |
| Molecular Weight | 260.55 |
| Density | 1.633g/cm3 |
| Boiling Point | 116-117°C 20mm |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| Packaging | III |
| HTC | 2918990090 |
| PubChem ID | 329781212 |
| MDL Number | MFCD01320685 |
| SMILES | Fc1c(F)c(F)c(OCC(Cl)=O)c(F)c1F |
| InChI | 1S/C8H2ClF5O2/c9-2(15)1-16-8-6(13)4(11)3(10)5(12)7(8)14/h1H2 |
| InChI Key | WQLJMPAQIWVNGS-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| Hazard Symbols | 8 |
| MSDS | msds/83730_1_55502_53_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nitro-m-tolunitrile | 96784-54-2 | 2A-9083719 |
| 3,6-Dibromonaphthalene-2,7-diol | 96965-79-6 | 2A-9083721 |
| DL-Cysteinehydrochloridehydrate | 96998-61-7 | 2A-9083722 |
| 3,5-Dibromobenzonitrile | 97165-77-0 | 2A-9083724 |
| Pentaerythrityltetrachloride | 3228-99-7 | 2A-9083729 |
| 2-Amino-5-iodobenzotrifluoride | 97760-97-9 | 2A-9083731 |
| Ractopaminehydrochloride | 97825-25-7 | 2A-9083732 |
| Pentamethylbenzenesulfonylchloride | 52499-94-2 | 2A-9083733 |
| 3-Phenoxyaniline | 3586-12-7 | 2A-9083734 |
| Naphtalene-1,4-dipropionicaciddisodiumsalt | 97860-58-7 | 2A-9083735 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA