
CAS Number651-80-9
Synonyms1,2,4,5-tetrafluoro-3-(trifluoromethyl)benzene; MFCD00012385
Molecular FormulaC7H1F7
Molecular Weight218.07
Density1.601 g/mL at 25 °C(lit.)
Boiling Point111-112 °C(lit.)
Melting Point111-112ºC(lit.)
AppearanceLiquid;Colorless to Almost colorless clear liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 651-80-9 |
| Catalog No. | 2A-9083698 |
| Chinese Name | 2,3,5,6-四氟三氟甲苯 |
| Synonyms | 1,2,4,5-tetrafluoro-3-(trifluoromethyl)benzene; MFCD00012385 |
| Molecular Formula | C7H1F7 |
| Molecular Weight | 218.07 |
| Density | 1.601 g/mL at 25 °C(lit.) |
| Boiling Point | 111-112 °C(lit.) |
| Melting Point | 111-112ºC(lit.) |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| Packaging | III |
| HTC | 2903999090 |
| MDL Number | MFCD00012385 |
| SMILES | Fc1cc(F)c(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C7HF7/c8-2-1-3(9)6(11)4(5(2)10)7(12,13)14/h1H |
| InChI Key | ZVPAJILXQHMKMT-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| MSDS | msds/83698_1_651_80_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1993 Proper shipping name: Flammable Liquid, not otherwise specified Packing grade: III |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Nitrophenacylaminehydrochloride | 36765-84-1 | 2A-9083679 |
| 4-Methoxy-N-methyl-N-isopropyltryptamine | 96096-53-6 | 2A-9083687 |
| 3-Bromo-4-hydroxy-2(1H)-pyridone | 96245-97-5 | 2A-9083689 |
| 3,5-Dimethoxyphenylhydrazine | 96406-93-8 | 2A-9083695 |
| Tetrafluoro-1,4-benzoquinone | 527-21-9 | 2A-9083696 |
| 2,3,5,6-Tetrafluorobenzylbromide | 53001-73-3 | 2A-9083700 |
| 2-(1,1,2,2-Tetrafluoroethoxy)benzoicacid | 10008-97-6 | 2A-9083701 |
| Methyl(p-formylphenyl)acetate | 96524-70-8 | 2A-0202509 |
| 3-(1,1,2,2,-Tetrafluoroethoxy)benzoicacid | 70126-48-6 | 2A-9083703 |
| 2-Bromo-3-chloroaniline | 96558-73-5 | 2A-9083704 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA