
CAS Number24566-79-8
Synonyms6-Phthalimido-1-bromohexane; N-(6-Bromohexyl)phthalimide; MFCD00023098
Molecular FormulaC14H16BrNO2
Molecular Weight310.18600
Purity98%
Density1.414 g/cm3
Boiling Point186-188°C 0,4mm
Melting Point55 °C
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24566-79-8 |
| Catalog No. | 2A-9008369 |
| Chinese Name | N-(6-溴己基)酞亚酸 |
| Synonyms | 6-Phthalimido-1-bromohexane; N-(6-Bromohexyl)phthalimide; MFCD00023098 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.18600 |
| Purity | 98 |
| Density | 1.414 g/cm3 |
| Boiling Point | 186-188°C 0,4mm |
| Melting Point | 55 °C |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Keep receptacle sealed Store in a compact containe |
| HTC | 2925190090 |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCBr |
| InChI | InChI=1S/C14H16BrNO2/c15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChI Key | OAZFTIPKNPTDIO-UHFFFAOYSA-N |
| MSDS | msds/8369_1_24566_79_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(4-Carboxyphenyl)guanidine hydrochloride | 42823-46-1 | 2A-9008361 |
| N-(4-Fluorobenzoylmethyl)-N-isopropylaniline | 2A-108362 | 2A-9008362 |
| N-(4-Methoxyphenyl)-3-oxo-butyramide | 5437-98-9 | 2A-9008363 |
| N-(4-Nitrophenyl)succinimide | 2A-108366 | 2A-9008366 |
| N-(5-Acetylamino-2-methoxyphenyl)-3-oxo-butyramide | 112854-88-3 | 2A-9008367 |
| N-(Bromoacetyl)-2'-chloroacetaniline | 5439-11-2 | 2A-9008370 |
| N-(Chloroacetyl)allylamine | 13269-97-1 | 2A-9008371 |
| N,6-Dimethyl-4-methoxy-1,3,5-triazin-2-ylamine | 5248-39-5 | 2A-9008375 |
| N,N,N',N'-Tetrabutylurea | 4559-86-8 | 2A-9008377 |
| N,N,N',N'-Tetramethyl-1,3-propanediamine | 110-95-2 | 2A-9008378 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA