
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 349-10-0 |
| Catalog No. | 2A-9083684 |
| Chinese Name | 3-三氟甲基扁桃酸 |
| Synonyms | D-3-trifluoromethyl-mandelic acid |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.14500 |
| Density | 1.481 g/cm3 |
| Boiling Point | 298.7ºC at 760 mmHg |
| Appearance | white solid |
| HTC | 2918199090 |
| SMILES | OC(C(O)=O)c1cccc(c1)C(F)(F)F |
| InChI | InChI=1S/C9H7F3O3/c10-9(11,12)6-3-1-2-5(4-6)7(13)8(14)15/h1-4,7,13H,(H,14,15) |
| InChI Key | InChIKey=WECBNRQPNXNRSJ-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4’-Trifluoromethylbiphenyl-3-carboxylicacid | 199528-28-4 | 2A-9083667 |
| 4'-Trifluoromethylbiphenyl-4-carboxylicacid | 195457-71-7 | 2A-9083669 |
| S-(Trifluoromethyl)-3,7-dinitrodibenzothiopheniumtrifluoromethanesulfonate | 129922-37-8 | 2A-9083673 |
| 9-Trifluoromethyl-9H-fluoren-9-ol | 120747-41-3 | 2A-9083676 |
| 4-Aminophenylboronicacidhydrate | 960355-27-5 | 2A-9083682 |
| 1,8-Diazaspiro[5.6]dodecane-1-carboxylicacid1,1-dimethylEthylester | 960616-53-9 | 2A-9083685 |
| 4-(Trifluoromethyl)mandelicacid | 395-35-7 | 2A-9083686 |
| 2-(Trifluoromethyl)-1,8-napthyridine-3-carboxylicacid | 241154-08-5 | 2A-9083688 |
| 4-(Trifluoromethyl)nicotinamide | 158062-71-6 | 2A-9083690 |
| N-Hexylboronicaciddiethanolamineester | 96472-47-8 | 2A-9083697 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA