
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 72220-50-9 |
| Catalog No. | 2A-9083530 |
| Chinese Name | 2-(4-三氟甲基苯氧基)乙酸 |
| Synonyms | MFCD00052352; [4-(Trifluoromethoxy)phenoxy]acetic acid; 2-[4-(trifluoromethoxy)phenoxy]acetic acid |
| Molecular Formula | C9H7F3O4 |
| Molecular Weight | 236.149 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 282.2±35.0 °C at 760 mmHg |
| Melting Point | 84-86°C |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918990090 |
| MDL Number | MFCD00052352 |
| SMILES | O=C(O)COc1ccc(OC(F)(F)F)cc1 |
| InChI Key | QHSBEEUEIRDHCD-UHFFFAOYSA-N |
| MSDS | msds/83530_1_72220_50_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(Trifluoromethoxy)benzoylchloride | 86270-03-3 | 2A-9083521 |
| 4-(Trifluoromethoxy)benzoylchloride | 36823-88-8 | 2A-9083523 |
| 2-(Trifluoromethoxy)benzylalcohol | 175278-07-6 | 2A-9083525 |
| 16-Hydroxyhexadecanoicacid | 506-13-8 | 2A-9083526 |
| 4-(Trifluoromethoxy)phenacylbromide | 103962-10-3 | 2A-9083529 |
| dl-2-[4-(Trifluoromethoxy)phenoxy]propionicacid | 175204-35-0 | 2A-9083535 |
| 4-(Trifluoromethoxy)phenylmethylsulfide | 2546-45-4 | 2A-9083542 |
| 4-(Trifluoromethoxy)phenylmethylsulfone | 87750-51-4 | 2A-9083544 |
| 1-(4-(Trifluoromethoxy)phenyl)-2-thiourea | 142229-74-1 | 2A-9083545 |
| (2R)-2-Amino-2-phenylbutanoicacid | 33875-38-6 | 2A-9083546 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA