CAS Number2016-04-8
SynonymsMethanamine,N,N-dimethyl-1,1-bis(phenylmethoxy); N,N-Dimethylformamide dibenzylacetal; DMF-dibenzyl acetal; MFCD00014869; EINECS 217-946-7; dimethyl formamide dibenzyl acetal; 1,1-di(benzyloxy)-N,N-dimethylmethanamine; 1,1-Dibenzyloxytrimethylamine
Molecular FormulaC17H21O2N1
Molecular Weight271.36
Density1.045 g/mL at 25 °C(lit.)
Boiling Point118-120 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2016-04-8 |
| Catalog No. | 2A-9083469 |
| Chinese Name | N,N-二甲基甲酰胺二苄基缩醛 |
| Synonyms | Methanamine,N,N-dimethyl-1,1-bis(phenylmethoxy); N,N-Dimethylformamide dibenzylacetal; DMF-dibenzyl acetal; MFCD00014869; EINECS 217-946-7; dimethyl formamide dibenzyl acetal; 1,1-di(benzyloxy)-N,N-dimethylmethanamine; 1,1-Dibenzyloxytrimethylamine |
| Molecular Formula | C17H21O2N1 |
| Molecular Weight | 271.36 |
| Density | 1.045 g/mL at 25 °C(lit.) |
| Boiling Point | 118-120 °C(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2922199090 |
| MDL Number | MFCD00014869 |
| SMILES | CN(C)C(OCc1ccccc1)OCc1ccccc1 |
| InChI Key | JFIKHFNGAURIIB-UHFFFAOYSA-N |
| MSDS | msds/83469_1_2016_04_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2'-Fluorobiphenyl-3-carbaldehyde | 676348-33-7 | 2A-9083421 |
| 4'-Fluorobiphenyl-2-carbaldehyde | 192863-46-0 | 2A-9083423 |
| 4'-Fluorobiphenyl-3-carbaldehyde | 164334-74-1 | 2A-9083424 |
| 5-(Trifluoromethyl)nicotinonitrile | 951624-83-2 | 2A-9083429 |
| 3-Fluoro-4-methylbenzamideoxime | 238742-80-8 | 2A-9083450 |
| Ethyl2-(trifluoromethyl)benzoate | 31083-13-3 | 2A-9083494 |
| Fluorene-2-carboxaldehyde | 30084-90-3 | 2A-9083495 |
| alpha-Furildioxime | 522-27-0 | 2A-9083499 |
| 4-Hydroxybutyricacidhydrazide | 3879-08-1 | 2A-9083522 |
| Iodomethyltrimethylammoniumiodide | 39741-91-8 | 2A-9083531 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS