CAS Number73357-18-3
Synonyms(4,5-dimethoxy-2-nitrophenyl)acetic acid; 3,4-dimethoxy-6-nitrophenylacetic acid; 2-nitro-4,5-dimethoxyphenylacetic acid; (4,5-dimethoxy-2-nitrophenyl)ethanoic acid; MFCD00118466; 2-(2-BROMOPHENOXY)ETHYL]DIMETHYLAMINE OXALATE
Molecular FormulaC10H11NO6
Molecular Weight241.202
Boiling Point433.4ºC at 760 mmHg
Melting Point206-208°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 73357-18-3 |
| Catalog No. | 2A-9083465 |
| Chinese Name | 4,5-二甲氧基-2-硝基苯乙酸 |
| Synonyms | (4,5-dimethoxy-2-nitrophenyl)acetic acid; 3,4-dimethoxy-6-nitrophenylacetic acid; 2-nitro-4,5-dimethoxyphenylacetic acid; (4,5-dimethoxy-2-nitrophenyl)ethanoic acid; MFCD00118466; 2-(2-BROMOPHENOXY)ETHYL]DIMETHYLAMINE OXALATE |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.202 |
| Boiling Point | 433.4ºC at 760 mmHg |
| Melting Point | 206-208°C |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2918990090 |
| MDL Number | MFCD00118466 |
| SMILES | COc1cc(CC(=O)O)c([N+](=O)[O-])cc1OC |
| InChI Key | WJPMJFUEMVXUCV-UHFFFAOYSA-N |
| MSDS | msds/83465_1_73357_18_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-Thienyl)-3-[(2,2,2-trifluoroacetyl)amino]propanoicacid | 115957-22-7 | 2A-9083457 |
| Terepthalbis(4-fluoroaniline) | 17866-84-1 | 2A-9083458 |
| 4-Fluoro-3-methylbenzoylchloride | 455-84-5 | 2A-9083461 |
| 2-Fluoro-3-methylbenzylbromide | 151412-12-3 | 2A-9083462 |
| 3,5-Dimethoxybenzoylchloride | 17213-57-9 | 2A-9083463 |
| 2-Dimethylaminobenzoicacid | 610-16-2 | 2A-9083466 |
| 1-(3-Dimethylaminopropyl)-3-ethylcarbodiimidemethiodide | 22572-40-3 | 2A-9083467 |
| N,N-Dimethylmethanesulfonamide | 918-05-8 | 2A-9083470 |
| 1,4-Diphenylbutadiyne | 886-66-8 | 2A-9083472 |
| 4,4-Diphenyl-2-butanone | 5409-60-9 | 2A-9083473 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS