
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 347-63-7 |
| Catalog No. | 2A-9083446 |
| Chinese Name | 3-(3-氟-4-甲氧基苯甲酰)丙酸 |
| Synonyms | 3-(3-fluoro-4-methoxybenzoyl)propionic acid; MFCD00020538; 3-(3-fluoro-para-anisoyl)-propionic acid; EINECS 206-474-7 |
| Molecular Formula | C23H18FN3O4 |
| Molecular Weight | 419.416 |
| Density | 1.279g/cm3 |
| Boiling Point | 422.6ºC at 760mmHg |
| Melting Point | 167-171 °C(lit.) |
| HTC | 2918990090 |
| MDL Number | MFCD04442167 |
| SMILES | COc1ccc(C(=O)CCC(=O)O)cc1F |
| InChI Key | SNRFVYKMDZSFED-UHFFFAOYSA-N |
| MSDS | msds/83446_1_347_63_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Fluorodiphenylmethane | 3794-15-8 | 2A-9083439 |
| 4-Fluorodiphenylmethane | 587-79-1 | 2A-9083440 |
| Isovanilin | 621-50-9 | 2A-9083442 |
| 5-Chloro-2,3-dibromo-1-fluorobenzene | 92771-38-5 | 2A-9083444 |
| 2-Fluoro-4'-methoxybenzophenone | 66938-29-2 | 2A-9083445 |
| 2-Fluoro-4-methylanisole | 399-55-3 | 2A-9083447 |
| 3-Fluoro-4-methylbenzamide | 175277-86-8 | 2A-9083448 |
| 5-Fluoro-2-methylbenzamide | 175278-28-1 | 2A-9083449 |
| 3-Fluoro-4-methylbenzamidinehydrochloride | 175277-88-0 | 2A-9083451 |
| 2-Fluoro-4-methylbenzenesulfonylchloride | 518070-29-6 | 2A-9083452 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA