
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 56442-17-2 |
| Catalog No. | 2A-9083415 |
| Chinese Name | 4-(4-氟苯甲氧基)苯甲醛 |
| Synonyms | 4-[(4-fluorophenyl)methoxy]benzaldehyde; MFCD00173650 |
| Molecular Formula | C14H11FO2 |
| Molecular Weight | 230.241 |
| Density | 1.29g/cm3 |
| Boiling Point | 194.3ºC at 760mmHg |
| Melting Point | 96-100 °C |
| Appearance | beige powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2913000090 |
| MDL Number | MFCD00173650 |
| SMILES | O=Cc1ccc(OCc2ccc(F)cc2)cc1 |
| InChI Key | QGULWBQOCMQNFD-UHFFFAOYSA-N |
| MSDS | msds/83415_1_56442_17_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Chloro-1-[1-(trifluoromethyl)-1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl]ethan-1-one | 257295-47-9 | 2A-9083385 |
| 1,4-Bis(chloromethyl)tetrafluorobenzene | 131803-37-7 | 2A-9083388 |
| 4-Fluorobenzaldehydeoxime | 588-95-4 | 2A-9083395 |
| 4-Methylsulfonylbenzaldehyde | 5389-77-6 | 2A-9083410 |
| 4-(2-Fluorobenzyloxy)benzaldehyde | 70627-20-2 | 2A-9083414 |
| 6-Chloro-3-fluoronicotinaldehyde | 950691-52-8 | 2A-9083419 |
| 2'-Fluorobiphenyl-3-carbaldehyde | 676348-33-7 | 2A-9083421 |
| 4'-Fluorobiphenyl-2-carbaldehyde | 192863-46-0 | 2A-9083423 |
| 4'-Fluorobiphenyl-3-carbaldehyde | 164334-74-1 | 2A-9083424 |
| 5-(Trifluoromethyl)nicotinonitrile | 951624-83-2 | 2A-9083429 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA