
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 208113-95-5 |
| Catalog No. | 2A-9083373 |
| Chinese Name | 2-异丙基丁二酸 |
| Synonyms | (S)-2-Isopropylsuccinic acid-1-methyl ester |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.19400 |
| Density | 1.092g/cm3 |
| Boiling Point | 272.4ºC at 760mmHg |
| Storage Condition | Sealed in a cool, dry environment at 4 ºC |
| HTC | 2918990090 |
| SMILES | COC(=O)C(CC(=O)[O-])C(C)C |
| InChI Key | VHOGSWBAPDPWTG-LURJTMIESA-M |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Pharmaceutical Intermediates | ||
|---|---|---|
| (R)-2-Isopropylamino-2-phenylethanol | 112211-92-4 | 2A-9083366 |
| (1S,2R)-2-(Isopropylamino)-1,2-diphenylethanol | 142508-07-4 | 2A-9083367 |
| (1R,2S)-2-(Isopropylamino)-1,2-diphenylethanol | 71653-81-1 | 2A-9083368 |
| Dehydroabiethylisothiocyanate | 115269-93-7 | 2A-9083369 |
| (R)-2-Isopropylsuccinicacid-1-methylester | 220498-08-8 | 2A-9083372 |
| (S)-2-Isocyanato-3-phenylpropionicacidmethylester | 40203-94-9 | 2A-9083375 |
| 2-(4-Fluorobenzyl)-2,5-diaza-bicyclo[2.2.1]heptane | 769099-80-1 | 2A-9083406 |
| 3-Fluorobenzylisothiocyanate | 63351-94-0 | 2A-9083409 |
| 4-Fluorobenzylisothiocyanate | 2740-88-7 | 2A-9083411 |
| Ethyl1,7-naphthyridine-3-carboxylate | 949922-44-5 | 2A-9083412 |
| Browse all Pharmaceutical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA