
CAS Number28871-62-7
Synonyms7-Oxa-bicyclo<2.2.1>hept-5-en-2-exo,3-cis-dicarbonsaeure; 7-Oxa-bicyclo-<2.2.1>-hept-5-en-2,3-exo,exo-dicarbonsaeure; exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic; 7-Oxa-norborn-5-en-2exo,3exo-dicarbonsaeure; 7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid; Epoepoxyxytetrahydrophthalicacid; 7-oxa-norborn-5-ene-2exo,3exo-dicarboxylic acid; 3,6-Oxa-1,2,3,6-tetrahydrophthalic Acid
Molecular FormulaC8H8O5
Molecular Weight166.13
Density1.6±0.1 g/cm3
Boiling Point464.5±45.0 °C at 760 mmHg
Melting Point118 °C (dec.) (lit.)
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28871-62-7 |
| Catalog No. | 2A-9083346 |
| Chinese Name | 外-3,6-环氧-1,2,3,6-四氢邻苯二甲酸 |
| Synonyms | 7-Oxa-bicyclo<2.2.1>hept-5-en-2-exo,3-cis-dicarbonsaeure; 7-Oxa-bicyclo-<2.2.1>-hept-5-en-2,3-exo,exo-dicarbonsaeure; exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic; 7-Oxa-norborn-5-en-2exo,3exo-dicarbonsaeure; 7-Oxabicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid; Epoepoxyxytetrahydrophthalicacid; 7-oxa-norborn-5-ene-2exo,3exo-dicarboxylic acid; 3,6-Oxa-1,2,3,6-tetrahydrophthalic Acid |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 166.13 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 464.5±45.0 °C at 760 mmHg |
| Melting Point | 118 °C (dec.) (lit.) |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2932999099 |
| PubChem ID | 24859882 |
| MDL Number | MFCD00151506 |
| SMILES | O=C1OC(=O)[C@H]2C3OC(C=C3)[C@@H]12 |
| InChI | 1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
| InChI Key | QQYNRBAAQFZCLF-FBXFSONDSA-N |
| Beilstein/REAXYS | 10355 |
| NACRES Code | NA.23 |
| UNSPSC | 12162002 |
| MSDS | msds/83346_1_28871_62_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 5Alpha-Androst-16-En-3Alpha-Ol | 1153-51-1 | 2A-0201972 |
| 2,5-Difluorophenylhydrazinehydrochloride | 175135-73-6 | 2A-9083339 |
| 4'-Chloro-5-fluoro-2-hydroxybenzophenone | 62433-26-5 | 2A-9083341 |
| (+)-Cycloisolongifol-5-ol | 74841-81-9 | 2A-9083344 |
| (-)-alpha-Gurjunene | 489-40-7 | 2A-9083345 |
| (+)-Camphanicacidchloride | 104530-16-7 | 2A-9083352 |
| 2-(Piperidinomethyl)-1-naphthol | 6638-91-1 | 2A-9083359 |
| Ethyl3,4-difluorobenzoate | 144267-96-9 | 2A-9083361 |
| Palladium,[1,3-bis[2,6-bis(1-methylethyl)phenyl]-1,3-dihydro-2H-imidazol-2-ylidene]chloro[2-[1-[(4-methylphenyl)imino-.kappa.N]ethyl]ferrocenyl-.kappa.C]- | 949536-98-5 | 2A-9083371 |
| 4-Oxo-4-piperidin-1-yl-butyricacid | 4672-17-7 | 2A-9083377 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA