
CAS Number32305-98-9
SynonymsEINECS 250-984-2; (2R,3R)-(-)-1,4-Bis(diphenylphosphino)-2,3-O-isopropylidene-2,3-butanediol; (2R,3R)-(-)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane; MLV 3077D; (((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(methylene))bis(diphenylphosphine); MFCD00014107; (-)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane; (−)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane
Molecular FormulaC31H32O2P2
Molecular Weight498.53
Purity98%
Boiling Point590.3ºC at 760mmHg
Melting Point88-90 °C (lit.)
Appearancewhite powder
EINECS250-984-2
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 32305-98-9 |
| Catalog No. | 2A-9083226 |
| Chinese Name | 异丙烯基-2,3-二羟基-1,4-双二苯基膦丁烷 |
| Synonyms | EINECS 250-984-2; (2R,3R)-(-)-1,4-Bis(diphenylphosphino)-2,3-O-isopropylidene-2,3-butanediol; (2R,3R)-(-)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane; MLV 3077D; (((4R,5R)-2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(methylene))bis(diphenylphosphine); MFCD00014107; (-)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane; (−)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane |
| Molecular Formula | C31H32O2P2 |
| Molecular Weight | 498.53 |
| Purity | 98 |
| Boiling Point | 590.3ºC at 760mmHg |
| Melting Point | 88-90 °C (lit.) |
| Appearance | white powder |
| Storage Condition | Seal and store at 0-6 ºC |
| EINECS | 250-984-2 |
| HTC | 2932999099 |
| PubChem ID | 24854261 |
| MDL Number | MFCD00014107 |
| SMILES | CC1(C)O[C@@H](CP(c2ccccc2)c3ccccc3)[C@H](CP(c4ccccc4)c5ccccc5)O1 |
| InChI | 1S/C31H32O2P2/c1-31(2)32-29(23-34(25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(33-31)24-35(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30H,23-24H2,1-2H3/t29-,30-/m0/s1 |
| InChI Key | VCHDBLPQYJAQSQ-KYJUHHDHSA-N |
| Beilstein/REAXYS | 1441045 |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| MSDS | msds/83226_1_32305_98_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Epsilon-formyl-L-lysine | 1190-48-3 | 2A-9083216 |
| 2-Deoxy-alpha-D-Ribose1-phosphateBis(cyclohexylamine)salt | 102783-28-8 | 2A-9083217 |
| 5-Phospho-alpha-D-Ribosyl-diphosphateSodiumsalt | 108321-05-7 | 2A-9083220 |
| s-(-)-1-Phenyl-1-butanol | 22135-49-5 | 2A-9083223 |
| (+)-XestosponginB | 123000-02-2 | 2A-9083224 |
| (-)-1,4-Di-O-tosyl-2,3-O-isopropylidenethreitol | 37002-45-2 | 2A-9083227 |
| 3,6-Endomethylene-1,2,3,6-tetrahydrophthaloylchloride | 4582-21-2 | 2A-9083230 |
| trans4-Methylcyclohexanol | 7731-29-5 | 2A-9083238 |
| Bis(1-methylpiperidin-4-yl)amine | 117927-28-3 | 2A-9083241 |
| Camphane | 473-19-8 | 2A-9083242 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA