
CAS Number943-88-4
Synonymsp-Anisalacetone; p-Anisylideneacetone; p-Anisilidenacetone; Methoxybenzalacetone; 4-(p-methoxyphenyl)-3-butene-2-one; p-Methoxybenzalacetone; (4-methoxybenzylidene)acetone; 4-Methoxybenzalacetone; 4-(p-methoxyphenyl)but-3-en-2-one; ANISALACETONE; 4-(p-methoxyphenyl)-3-buten-2-one; 4-(4-methoxyphenyl)-but-3-en-2-one; anisylideneacetone
Molecular FormulaC11H12O2
Molecular Weight176.21200
Density1.048g/cm3
Boiling Point319.8ºC at 760mmHg
Melting Point75-77ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 943-88-4 |
| Catalog No. | 2A-9083080 |
| Chinese Name | 4-(4-甲氧基苯基)-3-丁烯-2-酮 |
| Synonyms | p-Anisalacetone; p-Anisylideneacetone; p-Anisilidenacetone; Methoxybenzalacetone; 4-(p-methoxyphenyl)-3-butene-2-one; p-Methoxybenzalacetone; (4-methoxybenzylidene)acetone; 4-Methoxybenzalacetone; 4-(p-methoxyphenyl)but-3-en-2-one; ANISALACETONE; 4-(p-methoxyphenyl)-3-buten-2-one; 4-(4-methoxyphenyl)-but-3-en-2-one; anisylideneacetone |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21200 |
| Density | 1.048g/cm3 |
| Boiling Point | 319.8ºC at 760mmHg |
| Melting Point | 75-77ºC |
| Storage Condition | Room temperature, dry and sealed |
| HTC | 2914509090 |
| SMILES | COc1ccc(\C=C\C(C)=O)cc1 |
| InChI | InChI=1S/C11H12O2/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h3-8H,1-2H3/b4-3+ |
| InChI Key | InChIKey=WRRZKDVBPZBNJN-ONEGZZNKSA-N |
| MSDS | msds/83080_1_943_88_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Methyl-4-oxo-4-(3',4'-difluorophenyl)butyricacid | 191018-57-2 | 2A-9083061 |
| Adenylyl-imidodiphosphate,tetralithiumsalt | 72957-42-7 | 2A-9083070 |
| 2-[(4,6-Dimethoxypyrimidin-2-yl)oxy]benzoicacid | 110284-78-1 | 2A-9083074 |
| 2-[(4,6-Dimethoxypyrimidin-2-yl)thio]benzoicacid | 110284-79-2 | 2A-9083076 |
| 6-Chlorouracil | 4720-27-3 | 2A-9083077 |
| 4-[(4,6-Dimethylpyrimidin-2-yl)thio]phenol | 107718-34-3 | 2A-9083081 |
| 2-(4,6-Diamino-pyrimidin-2-ylsulfanyl)-butyricacid | 436088-61-8 | 2A-9083083 |
| 3-(4-Hydroxy-5-isopropyl-6-oxo-1,6-dihydro-pyrimidin-2-ylsulfanyl)-propionicacid | 337499-88-4 | 2A-9083091 |
| Bis(1H-benzo[d]imidazol-2-ylthio)methane | 85770-95-2 | 2A-9083095 |
| 4-Bromo-1-trityl-1H-imidazde | 87941-55-7 | 2A-9083104 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA