
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6265-92-5 |
| Catalog No. | 2A-9083018 |
| Chinese Name | 2-(4-甲氧苯基)苯并噻唑 |
| Synonyms | 2-(4-methoxyphenyl)-1,3-benzothiazole |
| Molecular Formula | C14H11O1N1S1 |
| Molecular Weight | 241.31 |
| Density | 1.234g/cm3 |
| Boiling Point | 392.5ºC at 760 mmHg |
| Melting Point | 122 °C |
| Appearance | Solid;Light yellow to Yellow to Green powder to crystal |
| Water Solubility | Soluble in: Toluene |
| Storage Condition | room temperature, dry |
| HTC | 2934200090 |
| MDL Number | MFCD01099069 |
| SMILES | COc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C14H11NOS/c1-16-11-8-6-10(7-9-11)14-15-12-4-2-3-5-13(12)17-14/h2-9H,1H3 |
| InChI Key | AOPZIJQISHFZBN-UHFFFAOYSA-N |
| MSDS | msds/83018_1_6265_92_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(1-Benzyl-5-methyl-1H-1,2,3-triazol-4-yl)-1-ethanone | 133992-60-6 | 2A-9082988 |
| 5-Chloro-6-methyluracil | 16018-87-4 | 2A-9083003 |
| 4-(1,3-Benzothiazol-2-yl)phenylamine | 6278-73-5 | 2A-9083006 |
| 4,5-Bis(dicyclohexylphosphino)-9,10a-dihydro-9,9-dimethyl-8aH-xanthene | 940934-47-4 | 2A-9083007 |
| 4-Trifluoromethoxybenzenesulfonylchloride | 94108-56-2 | 2A-9083010 |
| 3-Bromo-1-methylquinolin-2(1H)-one | 941-91-3 | 2A-9083021 |
| 4-Bromo-3-fluorophenylaceticacid | 942282-40-8 | 2A-9083022 |
| N3,N3-Dimethyl-1-phenyl-1,3-Propanediamine | 942-86-9 | 2A-9083027 |
| 2-Pyridinamine,5-bromo-4-chloro- | 942947-94-6 | 2A-9083029 |
| 2-(Piperazin-1-yl)-N-thiazol-2-yl-acetamidedihydrochloride | 84587-70-2 | 2A-9083030 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA