
CAS Number39890-42-1
Synonyms2-piperazin-1-yl-N-propan-2-ylacetamide; EINECS 254-676-9; N-ISOPROPYL-1-PIPERAZINEACETAMIDE; N-Isopropyl-2-(piperazin-1-yl)acetamide
Molecular FormulaC12H16N2O
Molecular Weight204.274
Density0.99 g/cm3
Boiling Point351.1ºC at 760 mmHg
Melting Point82-88ºC
AppearanceSlightly pale yellow crystals and blocks
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 39890-42-1 |
| Catalog No. | 2A-9082975 |
| Chinese Name | N-异丙基-1-哌啶乙酰胺 |
| Synonyms | 2-piperazin-1-yl-N-propan-2-ylacetamide; EINECS 254-676-9; N-ISOPROPYL-1-PIPERAZINEACETAMIDE; N-Isopropyl-2-(piperazin-1-yl)acetamide |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.274 |
| Density | 0.99 g/cm3 |
| Boiling Point | 351.1ºC at 760 mmHg |
| Melting Point | 82-88ºC |
| Appearance | Slightly pale yellow crystals and blocks |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2933599090 |
| MDL Number | MFCD18431723 |
| SMILES | CC(C)NC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C9H19N3O/c1-8(2)11-9(13)7-12-5-3-10-4-6-12/h8,10H,3-7H2,1-2H3,(H,11,13) |
| InChI Key | FFOHTSTWXWJGQR-UHFFFAOYSA-N |
| MSDS | msds/82975_1_39890_42_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 1-Isopropyl-1H-1,2,3-benzotriazole-5-carbonylchloride | 679806-67-8 | 2A-9082966 |
| Benzotriazole-4-sulfonicacid | 26725-50-8 | 2A-9082967 |
| 3,6-Dimethylpiperazine-2,5-dione | 5625-46-7 | 2A-9082969 |
| 6-Methyl-4-piperazino-2-(trifluoromethyl)quinoline | 544429-25-6 | 2A-9082973 |
| 1-[2-(Trifluoromethyl)quinol-4-yl]piperazine | 175203-79-9 | 2A-9082974 |
| Dihydro-5-phenyl-5-propyl-4,6(1H,5H)-pyrimidinedione | 59026-31-2 | 2A-9082976 |
| 4H-1,2,4-Triazole-4-propanol | 27106-94-1 | 2A-9082977 |
| 1H-1,2,3-Triazole-1-ethanol | 74731-63-8 | 2A-9082978 |
| 5,6-Dimethoxy-2-phenylindole | 62663-26-7 | 2A-9082979 |
| 1-Benzyl-5-methyl-1H-[1,2,3]triazole-4-carboxylicacid | 54698-60-1 | 2A-9082980 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA