
CAS Number19833-96-6
SynonymsBenzeneacetic acid, α-cyclopentyl-α-hydroxy-, methyl ester; Methylcyclopentyl(hydroxy)phenylacetat; MFCD00019295; Methyl cyclopentyl(hydroxy)phenylacetate; EINECS 243-359-0; Methyl cyclopentylphenylglycolate; UNII:QUE5YDO74D
Molecular FormulaC14H18O3
Molecular Weight234.29
Purity98%
Density1.2±0.1 g/cm3
Boiling Point357.5±22.0 °C at 760 mmHg
Appearanceliquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 19833-96-6 |
| Catalog No. | 2A-9008277 |
| Chinese Name | 2-环戊基-2-羟基苯乙酸甲酯 |
| Synonyms | Benzeneacetic acid, α-cyclopentyl-α-hydroxy-, methyl ester; Methylcyclopentyl(hydroxy)phenylacetat; MFCD00019295; Methyl cyclopentyl(hydroxy)phenylacetate; EINECS 243-359-0; Methyl cyclopentylphenylglycolate; UNII:QUE5YDO74D |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| Purity | 98 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 357.5±22.0 °C at 760 mmHg |
| Appearance | liquid |
| Storage Condition | Refrigerator |
| HTC | 2918199090 |
| SMILES | O(C)C(=O)C(O)(C2CCCC2)c1ccccc1 |
| InChI | 1S/C14H18O3/c1-17-13(15)14(16,12-9-5-6-10-12)11-7-3-2-4-8-11/h2-4,7-8,12,16H,5-6,9-10H2,1H3 |
| InChI Key | FGMUSNHTKNGVQD-UHFFFAOYSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/8277_1_19833_96_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl 6-bromo-2-naphthoate | 33626-98-1 | 2A-9008270 |
| Methyl 6-chloronicotinate | 73781-91-6 | 2A-9008271 |
| Methyl 6-nitroveratrate | 26791-93-5 | 2A-9008272 |
| Methyl 7-[3-(4-Fluorophenyl)-1-isopropyl-2,3-dihydroindol-2-yl]-3,5-dihydroxyhept-6-enoate | 2A-108273 | 2A-9008273 |
| Methyl 7-[3-(4-Fluorophenyl)-1-isopropyl-2,3-dihydroindol-2-yl]-5-hydroxy-3-oxohept-6-enoate | 2A-108274 | 2A-9008274 |
| Methyl D-(+)-lactate | 17392-83-5 | 2A-9008278 |
| Methyl D-2-(4-hydroxyphenoxy)propionate | 96562-58-2 | 2A-9008279 |
| Methyl difluorochloroacetic acid | 1514-87-0 | 2A-9008280 |
| Methyl dimethylbenzeneacetate | 2A-108281 | 2A-9008281 |
| Methyl DL-4-hydroxyphenylglycine | 2A-108282 | 2A-9008282 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA