
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41873-61-4 |
| Catalog No. | 2A-9082744 |
| Chinese Name | 2-(2-甲酰基苯氧基)乙酸乙酯 |
| Synonyms | MFCD00052131; ethyl o-formylphenoxyacetate; ethylformylphenoxyacetate; 2-formylphenoxyacetic acid ethyl ester |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.22 |
| Density | 1.169g/cm3 |
| Boiling Point | 322ºC at 760mmHg |
| Melting Point | 45-47ºC |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| MDL Number | MFCD00052131 |
| SMILES | CCOC(=O)COc1ccccc1C=O |
| InChI | InChI=1S/C11H12O4/c1-2-14-11(13)8-15-10-6-4-3-5-9(10)7-12/h3-7H,2,8H2,1H3 |
| InChI Key | YVWJJQUUORDFCC-UHFFFAOYSA-N |
| MSDS | msds/82744_1_41873_61_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(2-Chloroethoxy)benzaldehyde | 54373-15-8 | 2A-9082726 |
| 4-Nonyloxybenzaldehyde | 50262-46-9 | 2A-9082729 |
| 6-Bromo-2-hydroxy-3-methoxybenzaldehyde | 20035-41-0 | 2A-9082733 |
| 5-Cyano-1H-indole-2-boronicacid | 871329-64-5 | 2A-9082736 |
| 2-(4-Chlorophenylthio)benzaldehyde | 107572-07-6 | 2A-9082743 |
| 2,5-Thiophendiboronicacid | 26076-46-0 | 2A-9082764 |
| 1-(Phenylsulfonyl)-3-indoleboronicacid | 129271-98-3 | 2A-9082766 |
| 1-(Phenylsulfonyl)-2-indoleboronicacid | 342404-46-0 | 2A-9082775 |
| [2-(E-3-Methoxy-3-oxo-1-propen-1-yl)phenyl]boronicacid | 372193-68-5 | 2A-9082778 |
| 5-Bromo-4-(trifluoromethyl)pyrimidin-2-amine | 935534-47-7 | 2A-9082877 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA