CAS Number2967-66-0
SynonymsMethyl 4-trifluoromethylbenzoate; 4-trifluoromethylbenzoic acid methyl ester; 4-(Trifluoromethyl)benzoic Acid Methyl Ester; Methyl α,α,α-Trifluoro-p-toluate; methyl-4-(trifluoromethyl)benzoate; Benzoic acid, 4-(trifluoromethyl)-, methyl ester; methyl p-(trifluoromethyl)benzoate; methyl 4-(trifluoromethyl)-1-benzoate; Methyl 4-(trifluoromethyl)benzoate; MFCD00042324
Molecular FormulaCF3C6H4CO2CH3
Molecular Weight204.15
Purity99%
Density1.3±0.1 g/cm3
Boiling Point94-95 °C/21 mmHg (lit.)
Melting Point13-14 °C (lit.)
Appearanceliquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2967-66-0 |
| Catalog No. | 2A-9008263 |
| Chinese Name | 4-(三氟甲基)苯甲酸甲酯 |
| Synonyms | Methyl 4-trifluoromethylbenzoate; 4-trifluoromethylbenzoic acid methyl ester; 4-(Trifluoromethyl)benzoic Acid Methyl Ester; Methyl α,α,α-Trifluoro-p-toluate; methyl-4-(trifluoromethyl)benzoate; Benzoic acid, 4-(trifluoromethyl)-, methyl ester; methyl p-(trifluoromethyl)benzoate; methyl 4-(trifluoromethyl)-1-benzoate; Methyl 4-(trifluoromethyl)benzoate; MFCD00042324 |
| Molecular Formula | CF3C6H4CO2CH3 |
| Molecular Weight | 204.15 |
| Purity | 99 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 94-95 °C/21 mmHg (lit.) |
| Melting Point | 13-14 °C (lit.) |
| Appearance | liquid |
| Storage Condition | Protect from contact with moist air. |
| HTC | 2916399090 |
| UN(IATA) | UN 1993 |
| PubChem ID | 24860132 |
| MDL Number | MFCD00042324 |
| SMILES | COC(=O)c1ccc(cc1)C(F)(F)F |
| InChI | 1S/C9H7F3O2/c1-14-8(13)6-2-4-7(5-3-6)9(10,11)12/h2-5H,1H3 |
| InChI Key | VAZWXPJOOFSNLB-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | Xi |
| Risk Codes | R36/37/38 |
| Safety Description | S26;S37/39 |
| MSDS | msds/8263_2_2967_66_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 0.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| Methyl 2-chloro-3-(trifluoromethyl)benzoate | 2A-108222 | 2A-9008222 |
| Methyl 3-bromo-2-(bromomethyl)propionate | 22262-60-8 | 2A-9008246 |
| Methyl 3-trifluoromethylbenzoate | 2557-13-3 | 2A-9008248 |
| Methyl 4-[(trifluoromethyl)thio]benzoate | 88489-60-5 | 2A-9008250 |
| Methyl 4-aza-5alpha-androstan-3-one-17beta-carboxylate | 2A-108255 | 2A-9008255 |
| Methyl cyclohexanecarboxylate | 4630-82-4 | 2A-9008276 |
| N, N-Dimethylformamide propylene acetal | 2A-108374 | 2A-9008374 |
| N,N-Dimethylformamide dimethyl acetal | 4637-24-5 | 2A-9008401 |
| N-[3,5-Bis(trifluoromethyl)benzenesulphonyl]-L-methionine methyl ester | 175202-21-8 | 2A-9008415 |
| N-[3,5-Bis(trifluoromethyl)benzenesulphonyl]-L-methionyl hydrazide | 175202-22-9 | 2A-9008416 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS