
CAS Number70978-57-3
Synonymso-trifluoroacetyl-p-cresol; 2,2,2-Trifluoro-1-(2-hydroxy-5-methylphenyl)-ethanone; 2-(trifluoroacetyl)-4-methylphenol; 2,2,2-trifluoro-1-(2-hydroxy-5-methylphenyl)ethan-1-one; 2,2,2-TRICHLORO-1-(1H-INDOL-3-YL)-ETHANONE; EINECS 275-078-4; 2,2,2-tris(fluoranyl)-1-(5-methyl-2-oxidanyl-phenyl)ethanone
Molecular FormulaC9H7F3O2
Molecular Weight204.14600
Density1.342g/cm3
Boiling Point225.5ºC at 760 mmHg
Melting Point41ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 70978-57-3 |
| Catalog No. | 2A-9082493 |
| Chinese Name | 2,2,2-三氟-1-(2-羟基-5-甲基苯基)-乙酮 |
| Synonyms | o-trifluoroacetyl-p-cresol; 2,2,2-Trifluoro-1-(2-hydroxy-5-methylphenyl)-ethanone; 2-(trifluoroacetyl)-4-methylphenol; 2,2,2-trifluoro-1-(2-hydroxy-5-methylphenyl)ethan-1-one; 2,2,2-TRICHLORO-1-(1H-INDOL-3-YL)-ETHANONE; EINECS 275-078-4; 2,2,2-tris(fluoranyl)-1-(5-methyl-2-oxidanyl-phenyl)ethanone |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.14600 |
| Density | 1.342g/cm3 |
| Boiling Point | 225.5ºC at 760 mmHg |
| Melting Point | 41ºC |
| HTC | 2914700090 |
| SMILES | Cc1ccc(O)c(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O2/c1-5-2-3-7(13)6(4-5)8(14)9(10,11)12/h2-4,13H,1H3 |
| InChI Key | BQXJLIFASBKZNO-UHFFFAOYSA-N |
| MSDS | msds/82493_1_70978_57_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(1,4-Thiazinan-4-yl)acetonitrile | 53515-34-7 | 2A-9082460 |
| 6-Cyano-1-tetralone | 90401-84-6 | 2A-9082461 |
| (4-Chloroquinazolin-2-yl)-N,N-dimethylmethanamine | 91539-82-1 | 2A-9082472 |
| 2-Hydroxy-4,5,6-triMethylNicotinonitrile | 91591-59-2 | 2A-9082474 |
| 5-(4-Fluorophenyl)valericacid | 24484-22-8 | 2A-9082490 |
| 1,3-Propanediol,2,2-bis(hydroxymethyl)-,allylether | 91648-24-7 | 2A-9082496 |
| 2-Fluoro-3-hydroxybenzoicacid | 91658-92-3 | 2A-9082500 |
| 4-Methoxyphenacylthiocyanate | 6097-26-3 | 2A-9082502 |
| 5-Chloro-6-benzoxazolamine | 916791-64-5 | 2A-9082503 |
| 4-(2-Hydroxyhexafluoroisopropyl)benzoicacid | 16261-80-6 | 2A-9082526 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA