
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 134036-52-5 |
| Catalog No. | 2A-9082440 |
| Chinese Name | 酪氨酸磷酸化抑制剂AG490 |
| Synonyms | MFCD00209833 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30 |
| Purity | ≥98 (HPLC) |
| Density | 1.337g/cm3 |
| Boiling Point | 615.2ºC at 760mmHg |
| Melting Point | 215ºC |
| Appearance | solid |
| Water Solubility | ethanol: 5 mg/mL |
| Storage Condition | Seal and store at -20ºC |
| Application | (E/Z)-AG490 ((E/Z)-Tyrphostin AG490) is the racemate of (E)-AG490 and (Z)-AG490. (E)-AG490 (HY-12000) is a tyrosine kinase inhibitor that inhibits EGFR, Stat-3 and JAK2/3. |
| MDL Number | MFCD00236452 |
| SMILES | N(Cc2ccccc2)C(=O)\C(=C\c1cc(c(cc1)O)O)\C#N |
| InChI | 1S/C17H14N2O3/c18-10-14(8-13-6-7-15(20)16(21)9-13)17(22)19-11-12-4-2-1-3-5-12/h1-9,20-21H,11H2,(H,19,22)/b14-8+ |
| InChI Key | TUCIOBMMDDOEMM-RIYZIHGNSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/82440_1_134036_52_5.pdf |
| Transport Info | Product name: Tyrosine phosphorylation inhibitor aG490 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol | 911405-91-9 | 2A-9082393 |
| Tert-butylN-[2-amino-2-(3,4-dimethoxyphenyl)Ethyl]carbamate | 912762-97-1 | 2A-9082406 |
| 2-FluorophenEthylbromide | 91319-54-9 | 2A-9082412 |
| 2,6-Dibromo-1,5-dimethoxynaphthalene | 91394-96-6 | 2A-9082422 |
| 3-Fluoro-5-methoxybenzylbromide | 914637-29-9 | 2A-9082433 |
| 2-Acetylbenzenecarbonitrile | 91054-33-0 | 2A-9082446 |
| 4'-Cyano-2-(3-methoxyphenyl)acetophenone | 465514-67-4 | 2A-9082447 |
| 3-(2-Methyl-4-nitro-1H-imidazol-1-yl)propionitrile | 89128-08-5 | 2A-9082449 |
| 9,10-Dicyanoanthracene | 1217-45-4 | 2A-9082450 |
| 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile | 64399-27-5 | 2A-9082451 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA