
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5715-02-6 |
| Catalog No. | 2A-9082322 |
| Chinese Name | 2-乙酰氧基苯甲腈 |
| Synonyms | MFCD00017360; EINECS 227-210-7; (2-cyanophenyl) acetate |
| Molecular Formula | C9H7O2N1 |
| Molecular Weight | 161.16 |
| Density | 1.14 |
| Boiling Point | 119-121 |
| Melting Point | 252-254 °C |
| Appearance | Transparent colorless to slightly yellow liquid |
| Storage Condition | -20℃, room temperature, protected from light, in a |
| HTC | 2926909090 |
| MDL Number | MFCD00017360 |
| SMILES | CC(=O)Oc1ccccc1C#N |
| InChI | InChI=1S/C9H7NO2/c1-7(11)12-9-5-3-2-4-8(9)6-10/h2-5H,1H3 |
| InChI Key | XXLKCUTUGWSJJO-UHFFFAOYSA-N |
| MSDS | msds/82322_1_5715_02_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Diethylbis(2-cyanoethyl)malonate | 1444-05-9 | 2A-9082315 |
| 2-Mercapto-4,5,6-trimethylnicotinonitrile | 128917-84-0 | 2A-9082316 |
| 4-Nitrobenzylthiocyanate | 13287-49-5 | 2A-9082318 |
| 1-Acetamido-3-methyl-4-cyanosoqinoline | 179985-52-5 | 2A-9082319 |
| 1-Acetoxy-1-cyanoethylene | 3061-65-2 | 2A-9082321 |
| 2-Fluorobenzalchloride | 320-65-0 | 2A-9082324 |
| 2-Acetyl-5-cyanotiophene | 88653-55-8 | 2A-9082325 |
| 3-Acetyl-1,5-dicyano-3-methylpentane | 1681-17-0 | 2A-9082327 |
| 3-Fluorobenzalchloride | 402-64-2 | 2A-9082332 |
| 4-Fluorobenzalchloride | 456-19-9 | 2A-9082336 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA