
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 160430-64-8 |
| Catalog No. | 2A-9082320 |
| Chinese Name | 啶虫脒 |
| Synonyms | Acetamiprid; ACETAMIPRIISS; Assail; MFCD06201842; MOSPILDATE; MORTAL; MOSPILAN |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.67 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 352.4±52.0 °C at 760 mmHg |
| Melting Point | 100-102 °C |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2933399022 |
| PubChem ID | 329754617 |
| MDL Number | MFCD06201842 |
| SMILES | CN(Cc1ccc(Cl)nc1)\C(C)=N\C#N |
| InChI | 1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3/b14-8+ |
| InChI Key | WCXDHFDTOYPNIE-RIYZIHGNSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/82320_1_160430_64_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | S. Import and export pesticide registration certificate |
| Transport Info | Product name: Supervision conditions S. Import and export pesticide registration certificate |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dichloro-1,3-dimethyl-5-fluorobenzene | 214774-61-5 | 2A-9082102 |
| 2,4-Dichloro-5-fluorobenzotrifluoride | 112290-01-4 | 2A-9082103 |
| 3-Chloro-2,4-difluorobenzotrifluoride | 120770-03-8 | 2A-9082106 |
| 2,4-Difluoro-3-methylbromobenzene | 221220-97-9 | 2A-9082111 |
| 2,4-Dichloro-6-fluorobenzoicacid | 904285-09-2 | 2A-9082287 |
| 3-(Cyanomethyl)-2,4,5-trimethylthiophene | 112440-49-0 | 2A-9082348 |
| 2-[(2,4-Dichlorophenyl)sulfonyl]acetonitrile | 87475-64-7 | 2A-9082364 |
| 6,7-Dihydrothieno[3,2-d]pyrimidine-2,4-diol | 913581-92-7 | 2A-9082413 |
| 1-(2,4-Dichlorophenyl)-1-cyclopropylcyanide | 71463-55-3 | 2A-9082453 |
| 2,4-Dibromo-6-fluorophenylisothiocyanate | 244022-67-1 | 2A-9082513 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA