CAS Number90-53-9
Synonyms(2,3-Dimethoxyphenyl)acetic acid; 2,3-Dimethoxy phenyl acetic acid; MFCD00060351; (3,4-Dimethoxyphenyl)acetic acid; 3,4-Dimethoxyphenylacetic acid; 2,3-dimethoxyphenylacetic acid
Molecular FormulaC10H12O4
Molecular Weight196.2
Density1.2±0.1 g/cm3
Boiling Point318.2±27.0 °C at 760 mmHg
Melting Point82-84ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 90-53-9 |
| Catalog No. | 2A-9082293 |
| Chinese Name | 2,3-二甲氧基苯乙酸 |
| Synonyms | (2,3-Dimethoxyphenyl)acetic acid; 2,3-Dimethoxy phenyl acetic acid; MFCD00060351; (3,4-Dimethoxyphenyl)acetic acid; 3,4-Dimethoxyphenylacetic acid; 2,3-dimethoxyphenylacetic acid |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.2 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 318.2±27.0 °C at 760 mmHg |
| Melting Point | 82-84ºC |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| MDL Number | MFCD00060351 |
| SMILES | COc1cccc(CC(=O)O)c1OC |
| InChI | InChI=1S/C10H12O4/c1-13-8-5-3-4-7(6-9(11)12)10(8)14-2/h3-5H,6H2,1-2H3,(H,11,12) |
| InChI Key | UZULEJNWMHZSGY-UHFFFAOYSA-N |
| MSDS | msds/82293_1_90_53_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Potassiumtrifluoro(4-methoxybenzyl)borate | 900810-91-5 | 2A-9082267 |
| Seabuckthorn,Hippophaerhamnoides,ext. | 90106-68-6 | 2A-9082270 |
| N,N-Dimethyl(piperidin-3-yl)methanamine | 90203-05-7 | 2A-9082274 |
| 4-Methoxy-1-naphthonitrile | 5961-55-7 | 2A-9082276 |
| 4-(2-Methylaminomethyl-phenoxy)-benzenesulfonamide | 902836-97-9 | 2A-9082278 |
| Ethyl3-HydrazinoBenzoate | 90556-87-9 | 2A-9082297 |
| 1,4-Dithiane-2-carbonitrile | 175136-94-4 | 2A-9082304 |
| 2-Methoxy-1-naphthonitrile | 16000-39-8 | 2A-9082305 |
| 3-(4-Morpholinopropiononitrile | 4542-47-6 | 2A-9082308 |
| 7,7,8,8-Tetracyano-2,5-bis(2-hydroxyethoxy)quinodimethane | 58268-29-4 | 2A-9082309 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS