
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 78850-78-9 |
| Catalog No. | 2A-9082154 |
| Chinese Name | 间(2-氟苯氧基)甲苯 |
| Synonyms | 2-Fluorophenyl m-Tolyl Ether; 2-Fluoro-3'-methyldiphenyl Ether |
| Molecular Formula | C13H11FO |
| Molecular Weight | 277.17 |
| Density | 1.13 |
| Boiling Point | 111 °C |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | room temperature, dry |
| HTC | 2909309090 |
| PubChem ID | 24869385 |
| MDL Number | MFCD00078440 |
| SMILES | [H][C@]12CCCN1B(C)OC2(c3ccccc3)c4ccccc4 |
| InChI | 1S/C18H20BNO/c1-19-20-14-8-13-17(20)18(21-19,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17H,8,13-14H2,1H3/t17-/m1/s1 |
| InChI Key | VMKAFJQFKBASMU-QGZVFWFLSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352005 |
| MSDS | msds/82154_1_78850_78_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Industrial Applications | ||
|---|---|---|
| 4-(2,2-Difluorocyclopropyl)toluene | 54672-44-5 | 2A-9082147 |
| 2,2-Difluoroethylp-toluenesulfonate | 135206-84-7 | 2A-9082148 |
| s-(Trifluoroacetyl)-4-mercaptotoluene | 75072-07-0 | 2A-9082149 |
| 3-Chloro-5-fluorotoluene | 93857-90-0 | 2A-9082150 |
| 1H,1H-Pentafluoropropylp-toluenesulfonate | 565-42-4 | 2A-9082152 |
| m-(4-Fluorophenoxy)toluene | 1514-26-7 | 2A-9082155 |
| 2-(1-Methylpiperazin-2-yl)ethanol | 889939-92-8 | 2A-9082187 |
| (3-Chloropyrazin-2-yl)methanol | 89283-32-9 | 2A-9082206 |
| (3-Amino-5-nitrophenyl)methanol | 90390-46-8 | 2A-9082286 |
| N-Hexanesulphonylacetonitrile | 203310-42-3 | 2A-9082355 |
| Browse all Industrial Applications products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA