
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 583-02-8 |
| Catalog No. | 2A-9082116 |
| Chinese Name | 4-(三氟甲基)苯甲酸乙酯 |
| Synonyms | ethyl 4-(trifluoromethyl)benzoate; EINECS 209-486-0; MFCD00013563 |
| Molecular Formula | C10H9O2F3 |
| Molecular Weight | 218.18 |
| Density | 1.23 g/cm3 |
| Boiling Point | 90 °C |
| Appearance | Colorless - almost colorless transparent liquid |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2916399090 |
| MDL Number | MFCD00013563 |
| SMILES | CCOC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI Key | ZQDADDSPMCHZPX-UHFFFAOYSA-N |
| MSDS | msds/82116_1_583_02_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Isopropoxy-2-trifluoromethylphenylboronicacid | 313545-40-3 | 2A-9082109 |
| 2-Methoxy-4-(trifluoromethyl)-phenylboronicacid | 312936-89-3 | 2A-9082110 |
| Ethyl4-chloro-3-trifluoromethylcarbanilate | 18585-06-3 | 2A-9082112 |
| 2-(Trifluoromethyl)benzoicacidethylester | 577-62-8 | 2A-9082114 |
| 3-(Trifluoromethyl)benzoicacidethylester | 76783-59-0 | 2A-9082115 |
| 4-Nitro-3-(trifluoromethyl)benzenesulfonylchloride | 39234-83-8 | 2A-9082119 |
| 2-Bromo-4-(trifluoromethyl)benzenesulfonamide | 351003-63-9 | 2A-9082120 |
| Methylindolizine-7-carboxylate | 887602-89-3 | 2A-9082127 |
| 4-(Trifluoromethyl)diphenylether | 2A-9082131 | 2A-9082131 |
| Pentafluoro(trichloromethyl)benzene | 778-34-7 | 2A-9082132 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA