
CAS Number5292-42-2
Synonyms2,3,4,5-tetrafluorobenzoic acid methyl ester; Methyl 3,4,5,6-tetrafluorobenzoate; 1,2,3,4-Tetrafluorbenzoesaeuremethylester; 2,3,4,5-Tetrafluorbenzoesaeure-methylester; RARECHEM AL BF 0650; 2,3,22,23-DIOXIDOSQUALENE; METHYL 2,3,4,5-TETRAFLUOROBENZOATE; Benzoic acid,2,3,4,5-tetrafluoro-,Methyl ester; MFCD06203829
Molecular FormulaC8H4F4O2
Molecular Weight208.11000
Purity98%
Density1.443g/cm3
Boiling Point220.3ºC at 760 mmHg
AppearanceColorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5292-42-2 |
| Catalog No. | 2A-9008205 |
| Chinese Name | 2,3,4,5-四氟苯甲酸甲酯 |
| Synonyms | 2,3,4,5-tetrafluorobenzoic acid methyl ester; Methyl 3,4,5,6-tetrafluorobenzoate; 1,2,3,4-Tetrafluorbenzoesaeuremethylester; 2,3,4,5-Tetrafluorbenzoesaeure-methylester; RARECHEM AL BF 0650; 2,3,22,23-DIOXIDOSQUALENE; METHYL 2,3,4,5-TETRAFLUOROBENZOATE; Benzoic acid,2,3,4,5-tetrafluoro-,Methyl ester; MFCD06203829 |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11000 |
| Purity | 98 |
| Density | 1.443g/cm3 |
| Boiling Point | 220.3ºC at 760 mmHg |
| Appearance | Colorless to light yellow liquid |
| Storage Condition | Room Temperature |
| HTC | 2916399090 |
| SMILES | COC(=O)c1cc(F)c(F)c(F)c1F |
| InChI Key | MAEQYZYOSFAUAF-UHFFFAOYSA-N |
| MSDS | msds/8205_1_5292_42_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methenolone | 153-00-4 | 2A-9008197 |
| Methenolone acetate | 434-05-9 | 2A-9008198 |
| Methoxyamine hydrochloride | 593-56-6 | 2A-9008199 |
| Methyl (E)-4-chloro-3-methoxy-2-butenoate | 110104-60-4 | 2A-9008201 |
| Methyl 2-(2-chlorophenyl)-2-(2-(thiophen-2-yl)ethylamino)propanoate hydrochloride | 2A-108203 | 2A-9008203 |
| Methyl 2-acetyl-3-(2-chlorophenyl)acrylate | 67593-46-8 | 2A-9008211 |
| Methyl 2-acetylamino-3-chloropropionate | 18635-38-6 | 2A-9008212 |
| Methyl 2-amino-3-chlorobenzoate | 77820-58-7 | 2A-9008213 |
| Methyl 2-amino-5-bromobenzoate | 52727-57-8 | 2A-9008215 |
| Methyl 2-benzoylbenzoate | 606-28-0 | 2A-9008218 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA