
CAS Number177171-16-3
Synonyms[3-(Trimethylsilyl)phenyl]boronic acid; 3-(TriMethylsilyl)phenylboronic Acid; MFCD03093884; (3-trimethylsilylphenyl)boronic acid; 3-(Trimethylsilyl)benzeneboronic Acid; (3-(Trimethylsilyl)phenyl)boronic acid
Molecular FormulaC9H15BO2Si
Molecular Weight194.111
Density1.01
Boiling Point290 ºC
Melting Point138-140 ºC
AppearanceSolid;White to Almost white powder to crystal
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 177171-16-3 |
| Catalog No. | 2A-9082042 |
| Chinese Name | 3-(三甲基硅烷)苯硼酸 |
| Synonyms | [3-(Trimethylsilyl)phenyl]boronic acid; 3-(TriMethylsilyl)phenylboronic Acid; MFCD03093884; (3-trimethylsilylphenyl)boronic acid; 3-(Trimethylsilyl)benzeneboronic Acid; (3-(Trimethylsilyl)phenyl)boronic acid |
| Molecular Formula | C9H15BO2Si |
| Molecular Weight | 194.111 |
| Density | 1.01 |
| Boiling Point | 290 ºC |
| Melting Point | 138-140 ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2931900090 |
| SMILES | C[Si](C)(C)c1cccc(B(O)O)c1 |
| InChI Key | REMKRZLFPLDTKR-UHFFFAOYSA-N |
| MSDS | msds/82042_1_177171_16_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | AB (Inbound cargo customs clearance form) |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Semiconductor Chemical Intermediates | ||
|---|---|---|
| 1-(Tert-butylDimethylsilyloxy)-2-propanone | 74685-00-0 | 2A-9078128 |
| Tributyl(trimethylsilylethynyl)tin | 81353-38-0 | 2A-9079071 |
| 5-(Tert-Butyldimethylsilyloxy)-1-pentanol | 83067-20-3 | 2A-9079114 |
| Monomethyl(ethyleneglycol)propyltrichlorosilane | 36493-41-1 | 2A-9079270 |
| 2-Trimethylsilyl-1-ethylboronicacidpinacolester | 165904-20-1 | 2A-9082036 |
| 4-Trimethylsilylphenylboronicacid | 17865-11-1 | 2A-9082044 |
| 2-Trimethylsilyl-1-ethylboronicaciddiethanolamineester | 501014-43-3 | 2A-9082434 |
| 2-[(Trimethylsilyl)ethynyl]benzaldehyde | 77123-58-1 | 2A-9084064 |
| 3-(Trimethylsilyl)ethynylbenzaldehyde | 77123-55-8 | 2A-9084085 |
| 2-(Tert-butyldimethylsilyl)-1,3-dithiane | 95452-06-5 | 2A-9084191 |
| Browse all Semiconductor Chemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA