
CAS Number1701-19-5
Synonyms4-Hydroxy-8-methyl-2-trifluormethylchinolin; 8-methyl-2-(trifluoromethyl)quinolin-4-ol; MFCD00276592; 2-trifluoromethyl-4-hydroxy-8-methylquinoline; 8-Methyl-2-(trifluoromethyl)-4(1H)-quinolinone; 4-Hydroxy-8-methyl-2-(trifluoromethyl)quinoline
Molecular FormulaC11H8F3NO
Molecular Weight227.182
Density1.3±0.1 g/cm3
Boiling Point245.6±40.0 °C at 760 mmHg
Melting Point125-131°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1701-19-5 |
| Catalog No. | 2A-9081952 |
| Chinese Name | 8-甲基-2-(三氟甲基)喹啉-4-醇 |
| Synonyms | 4-Hydroxy-8-methyl-2-trifluormethylchinolin; 8-methyl-2-(trifluoromethyl)quinolin-4-ol; MFCD00276592; 2-trifluoromethyl-4-hydroxy-8-methylquinoline; 8-Methyl-2-(trifluoromethyl)-4(1H)-quinolinone; 4-Hydroxy-8-methyl-2-(trifluoromethyl)quinoline |
| Molecular Formula | C11H8F3NO |
| Molecular Weight | 227.182 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 245.6±40.0 °C at 760 mmHg |
| Melting Point | 125-131°C |
| Storage Condition | Keep container sealed and store in a cool, dry pla |
| HTC | 2933499090 |
| SMILES | Cc1cccc2c(=O)cc(C(F)(F)F)[nH]c12 |
| InChI Key | HLPDICBGZTVELB-UHFFFAOYSA-N |
| MSDS | msds/81952_1_1701_19_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-[2-Nitro-4-(trifluoromethyl)anilino]butanoicacid | 65783-35-9 | 2A-9081940 |
| 1-Chloro-2,4,6-tris(trifluoromethyl)benzene | 444-38-2 | 2A-9081943 |
| 2-Nitro-4-(trifluoromethylsulfonyl)chlorobenzene | 1550-27-2 | 2A-9081945 |
| 2-Chloro-1-(2-trifluoromethyl-phenothiazin-10-yl)-ethanone | 38221-55-5 | 2A-9081947 |
| 1-(2-[4-(Trifluoromethyl)phenyl]-1,3-thiazol-4-yl)ethan-1-one | 263564-37-0 | 2A-9081949 |
| 2-[Methyl-2-nitro-4-(trifluoromethyl)anilino]ethan-1-ol | 103748-04-5 | 2A-9081953 |
| 4-Fluorophenyl3-(trifluoromethyl)benzoate | 218929-27-2 | 2A-9081954 |
| Ethyl5-(4-chlorophenyl)-2-(trifluoromethyl)-3-furoate | 175276-59-2 | 2A-9081955 |
| 4-(Trifluoromethyl)benzalchloride | 82510-98-3 | 2A-9081959 |
| N,N-Dimethyl-3-(trifluoromethyl)benzamide | 90238-10-1 | 2A-9081960 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA